CAS 1423032-63-6

3,5-Diethyl-1-methyl-1H-pyrazole-4-sulfonyl chloride

Description:

3,5-Diethyl-1-methyl-1H-pyrazole-4-sulfonyl chloride is a chemical compound characterized by its sulfonyl chloride functional group, which is known for its reactivity and ability to form sulfonamides. This compound features a pyrazole ring, a five-membered heterocyclic structure containing two nitrogen atoms, contributing to its unique chemical properties. The presence of ethyl groups at the 3 and 5 positions and a methyl group at the 1 position enhances its lipophilicity and may influence its biological activity. As a sulfonyl chloride, it is likely to react with nucleophiles, making it useful in synthetic organic chemistry for the preparation of various derivatives, including sulfonamides. The compound may also exhibit specific physical properties such as solubility in organic solvents and stability under certain conditions, although detailed data on its melting point, boiling point, and other physical characteristics would require further investigation. Overall, 3,5-Diethyl-1-methyl-1H-pyrazole-4-sulfonyl chloride is a versatile intermediate in chemical synthesis with potential applications in pharmaceuticals and agrochemicals.

Formula: C₈H₁₃ClN₂O₂S

InChI: InChI=1S/C8H13ClN2O2S/c1-4-6-8(14(9,12)13)7(5-2)11(3)10-6/h4-5H2,1-3H3

InChI key: InChIKey=WEXDXTYRQWMMJU-UHFFFAOYSA-N

SMILES: S(Cl)(=O)(=O)C=1C(CC)=NN(C)C1CC

Synonyms:

• 1H-Pyrazole-4-sulfonyl chloride, 3,5-diethyl-1-methyl-
• 3,5-Diethyl-1-methyl-1H-pyrazole-4-sulfonyl chloride

3,5-Diethyl-1-methyl-1H-pyrazole-4-sulfonyl chloride

CAS: 1423032-63-6

Versatile small molecule scaffold

Formula: C₈H₁₃ClN₂O₂S

Purity: Min. 95%

Molecular weight: 236.72 g/mol

Ref: 3D-YGC03263