CAS 1423032-64-7

1H-Imidazole, 1-(3-bromopropyl)-2-methyl-, hydrobromide (1:1)

Description:

1H-Imidazole, 1-(3-bromopropyl)-2-methyl-, hydrobromide (1:1) is a chemical compound characterized by its imidazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features a 3-bromopropyl substituent at the 1-position and a methyl group at the 2-position of the imidazole ring, contributing to its unique properties. As a hydrobromide salt, it is typically encountered in a crystalline form, which enhances its solubility in polar solvents, particularly water. The presence of the bromine atom introduces significant reactivity, making it useful in various chemical syntheses and applications, including medicinal chemistry and material science. The compound's structure suggests potential biological activity, which may be explored in pharmacological studies. Additionally, the hydrobromide form indicates that it can act as a proton donor, influencing its behavior in different chemical environments. Overall, this compound exemplifies the diverse functionalities of imidazole derivatives in both organic synthesis and biological applications.

Formula: C₇H₁₁BrN₂·BrH

InChI: InChI=1S/C7H11BrN2.BrH/c1-7-9-4-6-10(7)5-2-3-8;/h4,6H,2-3,5H2,1H3;1H

InChI key: InChIKey=NNYJSVXZKVUKII-UHFFFAOYSA-N

SMILES: C(CCBr)N1C(C)=NC=C1.Br

Synonyms:

• 1H-Imidazole, 1-(3-bromopropyl)-2-methyl-, hydrobromide (1:1)

1-(3-Bromopropyl)-2-methyl-1H-imidazole hydrobromide

CAS: 1423032-64-7

Versatile small molecule scaffold

Formula: C₇H₁₂Br₂N₂

Purity: Min. 95%

Molecular weight: 283.99 g/mol

Ref: 3D-YGC03264