CAS 1423032-75-0

2-Thiophenesulfonamide, N-[(1-aminocyclohexyl)methyl]-, hydrochloride (1:1)

Description:

2-Thiophenesulfonamide, N-[(1-aminocyclohexyl)methyl]-, hydrochloride (1:1) is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. The presence of a thiophene ring contributes to its aromatic characteristics and potential biological activity. The compound features a cyclohexyl moiety attached to an amino group, suggesting possible interactions with biological targets, particularly in medicinal chemistry. As a hydrochloride salt, it is typically more soluble in water, enhancing its bioavailability for pharmaceutical applications. This compound may exhibit properties such as antimicrobial activity, making it of interest in drug development. Its molecular structure allows for various interactions with biological systems, which can be explored for therapeutic uses. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its pharmacological profile and potential applications in medicine.

Formula: C₁₁H₁₈N₂O₂S₂·ClH

InChI: InChI=1S/C11H18N2O2S2.ClH/c12-11(6-2-1-3-7-11)9-13-17(14,15)10-5-4-8-16-10;/h4-5,8,13H,1-3,6-7,9,12H2;1H

InChI key: InChIKey=GYVABRXLCJFHHG-UHFFFAOYSA-N

SMILES: C(NS(=O)(=O)C1=CC=CS1)C2(N)CCCCC2.Cl

Synonyms:

• 2-Thiophenesulfonamide, N-[(1-aminocyclohexyl)methyl]-, hydrochloride (1:1)

N-[(1-Aminocyclohexyl)methyl]thiophene-2-sulfonamide hydrochloride

CAS: 1423032-75-0

Versatile small molecule scaffold

Formula: C₁₁H₁₉ClN₂O₂S₂

Purity: Min. 95%

Molecular weight: 310.9 g/mol

Ref: 3D-YGC03275