CAS 1423032-81-8

Propanamide, N-(3-aminopropyl)-2-methyl-, hydrochloride (1:1)

Description:

Propanamide, N-(3-aminopropyl)-2-methyl-, hydrochloride (1:1) is a chemical compound characterized by its amide functional group, which is derived from propanoic acid. This substance features a 3-aminopropyl side chain, contributing to its potential biological activity and interaction with various receptors or enzymes. The presence of the hydrochloride indicates that it is a salt form, which often enhances solubility in water and stability. This compound may exhibit properties typical of amides, such as moderate polarity and the ability to participate in hydrogen bonding, influencing its solubility and reactivity. The molecular structure suggests potential applications in pharmaceuticals or biochemistry, particularly in drug development or as a biochemical probe. Its specific characteristics, including melting point, boiling point, and spectral data, would be essential for practical applications and further research. As with many amides, it may also exhibit low volatility and moderate thermal stability, making it suitable for various laboratory and industrial processes.

Formula: C₇H₁₆N₂O·ClH

InChI: InChI=1S/C7H16N2O.ClH/c1-6(2)7(10)9-5-3-4-8;/h6H,3-5,8H2,1-2H3,(H,9,10);1H

InChI key: InChIKey=XIBCSYCICLWQOM-UHFFFAOYSA-N

SMILES: C(NCCCN)(C(C)C)=O.Cl

Synonyms:

• Propanamide, N-(3-aminopropyl)-2-methyl-, hydrochloride (1:1)

N-(3-Aminopropyl)-2-methylpropanamide hydrochloride

CAS: 1423032-81-8

Versatile small molecule scaffold

Formula: C₇H₁₇ClN₂O

Purity: Min. 95%

Molecular weight: 180.67 g/mol

Ref: 3D-YGC03281