CAS 1423032-83-0

2-[[1-(Hydroxymethyl)cyclopentyl]methyl]-1H-isoindole-1,3(2H)-dione

Description:

2-[[1-(Hydroxymethyl)cyclopentyl]methyl]-1H-isoindole-1,3(2H)-dione is a chemical compound characterized by its complex structure, which includes an isoindole core and a hydroxymethyl-substituted cyclopentyl group. This compound features a bicyclic isoindole moiety, which is known for its potential biological activity and applications in medicinal chemistry. The presence of the hydroxymethyl group enhances its solubility and reactivity, making it a candidate for various chemical reactions. The molecular structure suggests potential interactions with biological targets, which may lead to pharmacological effects. Additionally, the compound may exhibit properties such as stability under certain conditions, but specific reactivity and solubility characteristics would depend on the surrounding environment and conditions. As with many organic compounds, its behavior in biological systems, including metabolism and toxicity, would require further investigation to fully understand its potential applications and safety profile. Overall, this compound represents a unique structure that may have implications in drug development and other chemical applications.

Formula: C₁₅H₁₇NO₃

InChI: InChI=1S/C15H17NO3/c17-10-15(7-3-4-8-15)9-16-13(18)11-5-1-2-6-12(11)14(16)19/h1-2,5-6,17H,3-4,7-10H2

InChI key: InChIKey=MRFCQBOMCJDDPM-UHFFFAOYSA-N

SMILES: C(N1C(=O)C=2C(C1=O)=CC=CC2)C3(CO)CCCC3

Synonyms:

• 2-[[1-(Hydroxymethyl)cyclopentyl]methyl]-1H-isoindole-1,3(2H)-dione
• 1H-Isoindole-1,3(2H)-dione, 2-[[1-(hydroxymethyl)cyclopentyl]methyl]-

2-{[1-(Hydroxymethyl)cyclopentyl]methyl}-2,3-dihydro-1H-isoindole-1,3-dione

CAS: 1423032-83-0

Versatile small molecule scaffold

Formula: C₁₅H₁₇NO₃

Purity: Min. 95%

Molecular weight: 259.3 g/mol

Ref: 3D-YGC03283