CAS 1423033-10-6

Urea, N,N-dimethyl-N′-[2-(methylamino)ethyl]-, hydrochloride (1:1)

Description:

Urea, N,N-dimethyl-N′-[2-(methylamino)ethyl]-, hydrochloride (1:1), with the CAS number 1423033-10-6, is a chemical compound characterized by its urea backbone modified with dimethyl and methylamino groups. This compound typically appears as a white crystalline solid and is soluble in water, which is a common trait for many hydrochloride salts. The presence of the hydrochloride indicates that it is a salt formed from the reaction of the base with hydrochloric acid, enhancing its stability and solubility in aqueous solutions. The functional groups present suggest potential applications in pharmaceuticals, particularly in drug formulation, due to their ability to interact with biological systems. Additionally, the compound may exhibit properties such as moderate to high polarity, which can influence its behavior in various chemical environments. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards. Overall, this compound's unique structure and properties make it of interest in both research and industrial applications.

Formula: C₆H₁₅N₃O·ClH

InChI: InChI=1S/C6H15N3O.ClH/c1-7-4-5-8-6(10)9(2)3;/h7H,4-5H2,1-3H3,(H,8,10);1H

InChI key: InChIKey=CKANUJBXFSRIKI-UHFFFAOYSA-N

SMILES: C(NCCNC)(N(C)C)=O.Cl

Synonyms:

• Urea, N,N-dimethyl-N′-[2-(methylamino)ethyl]-, hydrochloride (1:1)

1,1-Dimethyl-3-[2-(methylamino)ethyl]urea hydrochloride

CAS: 1423033-10-6

Versatile small molecule scaffold

Formula: C₆H₁₆ClN₃O

Purity: Min. 95%

Molecular weight: 181.66 g/mol

Ref: 3D-YGC03310