CAS 1423033-17-3

Benzeneethanamine, 2,6-dichloro-α-methyl-, hydrochloride (1:1)

Description:

Benzeneethanamine, 2,6-dichloro-α-methyl-, hydrochloride (1:1), with the CAS number 1423033-17-3, is a chemical compound characterized by its amine functional group and the presence of chlorine substituents on the benzene ring. This compound features a dichloro substitution pattern at the 2 and 6 positions of the aromatic ring, which can influence its reactivity and biological activity. The α-methyl group contributes to its steric properties, potentially affecting its interaction with biological targets. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, including pharmaceuticals. The presence of the amine group suggests potential basicity, allowing it to participate in acid-base reactions. Overall, this compound may exhibit specific pharmacological properties, making it of interest in medicinal chemistry, although detailed studies would be necessary to elucidate its full profile and potential applications.

Formula: C₉H₁₁Cl₂N·ClH

InChI: InChI=1S/C9H11Cl2N.ClH/c1-6(12)5-7-8(10)3-2-4-9(7)11;/h2-4,6H,5,12H2,1H3;1H

InChI key: InChIKey=GOFYHVBZDVPUKP-UHFFFAOYSA-N

SMILES: C(C(C)N)C1=C(Cl)C=CC=C1Cl.Cl

Synonyms:

• Benzeneethanamine, 2,6-dichloro-α-methyl-, hydrochloride (1:1)

1-(2,6-Dichlorophenyl)propan-2-amine hydrochloride

Controlled Product

CAS: 1423033-17-3

Versatile small molecule scaffold

Formula: C₉H₁₂Cl₃N

Purity: Min. 95%

Molecular weight: 240.6 g/mol

Ref: 3D-YGC03317