CAS 1423033-27-5

Benzenepropanoic acid, α-(aminomethyl)-4-methyl-, hydrochloride (1:1)

Description:

Benzenepropanoic acid, α-(aminomethyl)-4-methyl-, hydrochloride (1:1) is a chemical compound characterized by its structure, which includes a benzene ring substituted with a propanoic acid group and an aminomethyl group at the alpha position, along with a methyl group at the para position. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and may influence its biological activity. The presence of the amino group suggests potential for interactions with biological systems, making it of interest in pharmaceutical applications. The molecular structure contributes to its acidity, with the carboxylic acid group capable of donating protons in solution. Additionally, the compound may exhibit various functional properties, including potential antimicrobial or anti-inflammatory activities, depending on its specific interactions within biological contexts. As with many organic compounds, safety and handling precautions are essential due to potential toxicity or reactivity. Further studies would be necessary to fully elucidate its properties and applications in medicinal chemistry.

Formula: C₁₁H₁₅NO₂·ClH

InChI: InChI=1S/C11H15NO2.ClH/c1-8-2-4-9(5-3-8)6-10(7-12)11(13)14;/h2-5,10H,6-7,12H2,1H3,(H,13,14);1H

InChI key: InChIKey=KVVQDEQTFFUPMQ-UHFFFAOYSA-N

SMILES: C(C(C(O)=O)CN)C1=CC=C(C)C=C1.Cl

Synonyms:

• Benzenepropanoic acid, α-(aminomethyl)-4-methyl-, hydrochloride (1:1)

3-Amino-2-[(4-methylphenyl)methyl]propanoic acid hydrochloride

CAS: 1423033-27-5

Versatile small molecule scaffold

Formula: C₁₁H₁₆ClNO₂

Purity: Min. 95%

Molecular weight: 229.7 g/mol

Ref: 3D-YGC03327