
CAS 1423033-28-6
:2H-1-Benzopyran-4-amine, 8-bromo-3,4-dihydro-N,2,2-trimethyl-, hydrochloride (1:1)
Description:
2H-1-Benzopyran-4-amine, 8-bromo-3,4-dihydro-N,2,2-trimethyl-, hydrochloride (1:1) is a chemical compound characterized by its complex structure, which includes a benzopyran moiety and an amine functional group. The presence of the bromine atom at the 8-position contributes to its reactivity and potential biological activity. The compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and facilitates its use in various applications, including pharmaceuticals and research. The trimethyl groups at the nitrogen atom indicate steric hindrance, which may influence the compound's interaction with biological targets. This compound may exhibit properties such as fluorescence or specific binding affinities, making it of interest in medicinal chemistry. As with many organic compounds, its stability, solubility, and reactivity can be influenced by environmental factors such as pH and temperature. Safety data and handling precautions should be observed due to the presence of bromine and the potential for biological activity.
Formula:C12H16BrNO·ClH
InChI:InChI=1S/C12H16BrNO.ClH/c1-12(2)7-10(14-3)8-5-4-6-9(13)11(8)15-12;/h4-6,10,14H,7H2,1-3H3;1H
InChI key:InChIKey=ICRLRBIYJHBJBA-UHFFFAOYSA-N
SMILES:N(C)C1C=2C(OC(C)(C)C1)=C(Br)C=CC2.Cl
Synonyms:- 2H-1-Benzopyran-4-amine, 8-bromo-3,4-dihydro-N,2,2-trimethyl-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.