CAS 1423034-12-1

Benzenemethanamine, 3-bromo-5-methoxy-4-(phenylmethoxy)-, hydrochloride (1:1)

Description:

Benzenemethanamine, 3-bromo-5-methoxy-4-(phenylmethoxy)-, hydrochloride (1:1), identified by CAS number 1423034-12-1, is a chemical compound characterized by its complex structure that includes a benzene ring substituted with various functional groups. The presence of a bromine atom and a methoxy group indicates potential reactivity and solubility properties, while the phenylmethoxy group suggests the compound may exhibit significant hydrophobic characteristics. As a hydrochloride salt, it is likely to be more soluble in water compared to its free base form, which can enhance its bioavailability in pharmaceutical applications. The compound may exhibit biological activity, potentially acting as a ligand or inhibitor in various biochemical pathways. Its synthesis and characterization would typically involve standard organic chemistry techniques, including purification methods such as recrystallization or chromatography. Safety data sheets should be consulted for handling and storage guidelines, as well as potential hazards associated with its use in laboratory or industrial settings.

Formula: C₁₅H₁₆BrNO₂·ClH

InChI: InChI=1S/C15H16BrNO2.ClH/c1-18-14-8-12(9-17)7-13(16)15(14)19-10-11-5-3-2-4-6-11;/h2-8H,9-10,17H2,1H3;1H

InChI key: InChIKey=XLLSOACZSXEHOP-UHFFFAOYSA-N

SMILES: O(CC1=CC=CC=C1)C2=C(OC)C=C(CN)C=C2Br.Cl

Synonyms:

• Benzenemethanamine, 3-bromo-5-methoxy-4-(phenylmethoxy)-, hydrochloride (1:1)

[4-(Benzyloxy)-3-bromo-5-methoxyphenyl]methanamine hydrochloride

CAS: 1423034-12-1

Versatile small molecule scaffold

Formula: C₁₅H₁₇BrClNO₂

Purity: Min. 95%

Molecular weight: 358.66 g/mol

Ref: 3D-YGC03412