CAS 1423034-20-1

1(2H)-Pyridineacetic acid, 3-amino-2-oxo-, hydrochloride (1:1)

Description:

1(2H)-Pyridineacetic acid, 3-amino-2-oxo-, hydrochloride (1:1) is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features an acetic acid moiety and an amino group, contributing to its potential biological activity. The hydrochloride form indicates that it is a salt formed with hydrochloric acid, enhancing its solubility in water and making it suitable for various applications, particularly in pharmaceutical contexts. The presence of the amino and keto functional groups suggests that it may participate in various chemical reactions, including nucleophilic substitutions and condensation reactions. Its molecular structure allows for potential interactions with biological targets, making it of interest in medicinal chemistry. As with many pyridine derivatives, it may exhibit properties such as antimicrobial or anti-inflammatory activities, although specific biological effects would depend on further empirical studies. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₇H₈N₂O₃·ClH

InChI: InChI=1S/C7H8N2O3.ClH/c8-5-2-1-3-9(7(5)12)4-6(10)11;/h1-3H,4,8H2,(H,10,11);1H

InChI key: InChIKey=KJYOAQRPJZPJNG-UHFFFAOYSA-N

SMILES: C(C(O)=O)N1C(=O)C(N)=CC=C1.Cl

Synonyms:

• 1(2H)-Pyridineacetic acid, 3-amino-2-oxo-, hydrochloride (1:1)

2-(3-Amino-2-oxo-1,2-dihydropyridin-1-yl)acetic acid hydrochloride

Controlled Product

CAS: 1423034-20-1

2-(3-Amino-2-oxo-1,2-dihydropyridin-1-yl)acetic acid hydrochloride is a peptide that can be used as a research tool to activate ion channels. It is also an inhibitor of the ligand binding site of the GABA receptor. 2-(3-Amino-2-oxo-1,2-dihydropyridin-1-yl)acetic acid hydrochloride is soluble in water and has a molecular weight of 251.25 g/mol. CAS No: 1423034-20-1

Formula: C₇H₉ClN₂O₃

Purity: Min. 95%

Molecular weight: 204.61 g/mol

Ref: 3D-YGC03420