CAS 1423034-46-1

4-Pyridineethanamine, 1,2,3,6-tetrahydro-1-methyl-, hydrochloride (1:2)

Description:

4-Pyridineethanamine, 1,2,3,6-tetrahydro-1-methyl-, hydrochloride (1:2) is a chemical compound characterized by its pyridine and amine functional groups. It typically appears as a white to off-white crystalline solid and is soluble in water due to the presence of the hydrochloride salt form, which enhances its solubility. The compound is a derivative of tetrahydropyridine, indicating a saturated cyclic structure that contributes to its stability and reactivity. It may exhibit biological activity, potentially interacting with neurotransmitter systems, which makes it of interest in pharmaceutical research. The hydrochloride form indicates that it is a salt, which can influence its pharmacokinetics and bioavailability. Safety data should be consulted for handling and potential toxicity, as with any chemical substance. Overall, this compound's unique structure and properties make it a subject of interest in both synthetic chemistry and medicinal applications.

Formula: C₈H₁₆N₂·2ClH

InChI: InChI=1S/C8H16N2.2ClH/c1-10-6-3-8(2-5-9)4-7-10;;/h3H,2,4-7,9H2,1H3;2*1H

InChI key: InChIKey=IHTOTKQORWPBDU-UHFFFAOYSA-N

SMILES: C(CN)C=1CCN(C)CC1.Cl

Synonyms:

• 4-Pyridineethanamine, 1,2,3,6-tetrahydro-1-methyl-, hydrochloride (1:2)

2-(1-Methyl-1,2,3,6-tetrahydropyridin-4-yl)ethan-1-amine dihydrochloride

CAS: 1423034-46-1

Versatile small molecule scaffold

Formula: C₈H₁₈Cl₂N₂

Purity: Min. 95%

Molecular weight: 213.15 g/mol

Ref: 3D-YGC03446