CAS 1423034-67-6

3-Thiophenesulfonamide, N-(2-amino-2-phenylethyl)-2,5-dimethyl-, hydrochloride (1:1)

Description:

3-Thiophenesulfonamide, N-(2-amino-2-phenylethyl)-2,5-dimethyl-, hydrochloride (1:1) is a chemical compound characterized by its sulfonamide functional group, which is known for its antibacterial properties. The presence of a thiophene ring contributes to its aromaticity and potential biological activity. This compound features a substituted amine, specifically an amino group attached to a phenylethyl moiety, which may enhance its interaction with biological targets. The hydrochloride form indicates that it is a salt, which often improves solubility in water and stability. The molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Its specific properties, such as melting point, solubility, and reactivity, would depend on the precise arrangement of atoms and the presence of functional groups. As with many sulfonamides, it may exhibit antibacterial or anti-inflammatory activities, making it of interest in therapeutic research. However, detailed studies would be necessary to fully elucidate its pharmacological profile and potential applications.

Formula: C₁₄H₁₈N₂O₂S₂·ClH

InChI: InChI=1S/C14H18N2O2S2.ClH/c1-10-8-14(11(2)19-10)20(17,18)16-9-13(15)12-6-4-3-5-7-12;/h3-8,13,16H,9,15H2,1-2H3;1H

InChI key: InChIKey=ILDKDHKYNHLTBO-UHFFFAOYSA-N

SMILES: S(NCC(N)C1=CC=CC=C1)(=O)(=O)C=2C=C(C)SC2C.Cl

Synonyms:

• 3-Thiophenesulfonamide, N-(2-amino-2-phenylethyl)-2,5-dimethyl-, hydrochloride (1:1)

N-(2-Amino-2-phenylethyl)-2,5-dimethylthiophene-3-sulfonamide hydrochloride

CAS: 1423034-67-6

Versatile small molecule scaffold

Formula: C₁₄H₁₉ClN₂O₂S₂

Purity: Min. 95%

Molecular weight: 346.9 g/mol

Ref: 3D-YGC03467