CAS 1423034-86-9

Alanine, N-cyclopentyl-N,2-dimethyl-, hydrochloride (1:1)

Description:

Alanine, N-cyclopentyl-N,2-dimethyl-, hydrochloride (1:1) is a synthetic amino acid derivative characterized by the presence of a cyclopentyl group and two methyl groups attached to the nitrogen atom of the alanine backbone. This compound is typically encountered as a hydrochloride salt, which enhances its solubility in water and stability. The presence of the cyclopentyl group contributes to its hydrophobic characteristics, potentially influencing its interactions in biological systems. As an amino acid derivative, it may participate in various biochemical processes, including protein synthesis and enzyme activity modulation. The hydrochloride form indicates that it can exist as a stable crystalline solid, making it suitable for various applications in research and pharmaceuticals. Its unique structure may also impart specific pharmacological properties, making it of interest in medicinal chemistry. However, detailed studies on its biological activity, toxicity, and specific applications would be necessary to fully understand its potential uses and implications in scientific research.

Formula: C₁₀H₁₉NO₂·ClH

InChI: InChI=1S/C10H19NO2.ClH/c1-10(2,9(12)13)11(3)8-6-4-5-7-8;/h8H,4-7H2,1-3H3,(H,12,13);1H

InChI key: InChIKey=NYBHQGSVQLIYEH-UHFFFAOYSA-N

SMILES: C(N(C)C1CCCC1)(C(O)=O)(C)C.Cl

Synonyms:

• Alanine, N-cyclopentyl-N,2-dimethyl-, hydrochloride (1:1)

2-[Cyclopentyl(methyl)amino]-2-methylpropanoic acid hydrochloride

CAS: 1423034-86-9

Versatile small molecule scaffold

Formula: C₁₀H₂₀ClNO₂

Purity: Min. 95%

Molecular weight: 221.72 g/mol

Ref: 3D-YGC03486