CAS 1423035-04-4

2-Pyridinecarboxylic acid, 6-(4-methyl-1-piperazinyl)-, hydrochloride (1:2)

Description:

2-Pyridinecarboxylic acid, 6-(4-methyl-1-piperazinyl)-, hydrochloride (1:2) is a chemical compound characterized by its pyridine and piperazine moieties, which contribute to its biological activity and solubility properties. The presence of the carboxylic acid functional group indicates that it can participate in acid-base reactions, while the piperazine ring enhances its potential as a pharmacological agent due to its ability to interact with various biological targets. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, facilitating its use in pharmaceutical formulations. The compound may exhibit properties such as moderate to high polarity, which can influence its distribution and absorption in biological systems. Its structural features suggest potential applications in medicinal chemistry, particularly in the development of therapeutics targeting neurological or psychiatric conditions. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.

Formula: C₁₁H₁₅N₃O₂·2ClH

InChI: InChI=1S/C11H15N3O2.2ClH/c1-13-5-7-14(8-6-13)10-4-2-3-9(12-10)11(15)16;;/h2-4H,5-8H2,1H3,(H,15,16);2*1H

InChI key: InChIKey=NSKHXCVTFKMCJO-UHFFFAOYSA-N

SMILES: C(O)(=O)C1=NC(=CC=C1)N2CCN(C)CC2.Cl

Synonyms:

• 2-Pyridinecarboxylic acid, 6-(4-methyl-1-piperazinyl)-, hydrochloride (1:2)

6-(4-Methylpiperazin-1-yl)pyridine-2-carboxylic acid dihydrochloride

CAS: 1423035-04-4

Versatile small molecule scaffold

Formula: C₁₁H₁₇Cl₂N₃O₂

Purity: Min. 95%

Molecular weight: 294.17 g/mol

Ref: 3D-YGC03504