CAS 142329-22-4

6-TRIFLUOROMETHYL-BENZO[B]THIOPHENE-2-CARBOXYLIC ACID

Description:

6-Trifluoromethyl-benzo[b]thiophene-2-carboxylic acid is an organic compound characterized by its unique structure, which includes a trifluoromethyl group and a benzo[b]thiophene moiety. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity in various chemical reactions. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its biological activity, making it of interest in medicinal chemistry and material science. The benzo[b]thiophene framework provides aromatic stability and can participate in π-π stacking interactions, which may be relevant in the development of organic semiconductors or pharmaceuticals. Additionally, the compound's properties, such as solubility and melting point, can be influenced by the presence of the trifluoromethyl and carboxylic acid groups. Overall, 6-Trifluoromethyl-benzo[b]thiophene-2-carboxylic acid is a versatile compound with potential applications in various fields, including agrochemicals and advanced materials.

Formula: C₁₀H₅F₃O₂S

InChI: InChI=1/C10H5F3O2S/c11-10(12,13)6-2-1-5-3-8(9(14)15)16-7(5)4-6/h1-4H,(H,14,15)

SMILES: c1cc(cc2c1cc(C(=O)O)s2)C(F)(F)F

Synonyms:

• 6-(Trifluoromethyl)-1-Benzothiophene-2-Carboxylic Acid

6-(Trifluoromethyl)-1-benzothiophene-2-carboxylic acid

CAS: 142329-22-4

Formula: C₁₀H₅F₃O₂S

Purity: 98%

Color and Shape: Solid

Molecular weight: 246.2057

Ref: IN-DA009DQS

6-(Trifluoromethyl)benzo[b]thiophene-2-carboxylic acid

CAS: 142329-22-4

6-(Trifluoromethyl)benzo[b]thiophene-2-carboxylic acid

Formula: C₁₀H₅F₃O₂S

Purity: ≥95%

Color and Shape: white to off-white crystalline powder

Molecular weight: 246.21g/mol

Ref: 54-PC8616

6-(Trifluoromethyl)benzo[b]thiophene-2-carboxylic acid

CAS: 142329-22-4

Formula: C₁₀H₅F₃O₂S

Purity: 98%

Molecular weight: 246.2

Ref: 10-F217828