CAS 142341-04-6
:{[{[2-(6-amino-9H-purin-9-yl)ethoxy]methyl}(ethoxy)phosphoryl]oxy}methyl 2,2-dimethylpropanoate
Description:
The chemical substance with the name "{[{[2-(6-amino-9H-purin-9-yl)ethoxy]methyl}(ethoxy)phosphoryl]oxy}methyl 2,2-dimethylpropanoate" and CAS number 142341-04-6 is a complex organic compound that features a purine base, specifically 6-amino-9H-purine, which is a derivative of adenine. This compound contains multiple functional groups, including an ethoxy group and a phosphoryl moiety, indicating potential biological activity, particularly in the context of nucleoside analogs or prodrugs. The presence of the dimethylpropanoate group suggests that it may exhibit lipophilic properties, which could influence its solubility and permeability in biological systems. The structural complexity and the presence of nitrogen and phosphorus atoms imply that this compound may interact with biological macromolecules, such as nucleic acids or proteins, potentially affecting cellular processes. Overall, its characteristics suggest it may have applications in medicinal chemistry, particularly in the development of antiviral or anticancer agents. Further studies would be necessary to elucidate its specific biological activities and mechanisms of action.
Formula:C16H26N5O6P
InChI:InChI=1/C16H26N5O6P/c1-5-26-28(23,27-10-25-15(22)16(2,3)4)11-24-7-6-21-9-20-12-13(17)18-8-19-14(12)21/h8-9H,5-7,10-11H2,1-4H3,(H2,17,18,19)
SMILES:CCOP(=O)(COCCn1cnc2c(N)ncnc12)OCOC(=O)C(C)(C)C
Synonyms:- 2,2-Dimethylpropanoic Acid [[[[2-(6-Amino-9H-Purin-9-Yl)Ethoxy]Methyl]Ethoxyphosphinyl]Oxy]Methyl Ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
Adefovir Dipivoxil Impurity 21
CAS:Formula:C16H26N5O6PColor and Shape:Off-White SolidMolecular weight:415.39

