CAS 142347-81-7
:Trans-4-Hydroxy-D-proline hydrochloride
Description:
Trans-4-Hydroxy-D-proline hydrochloride is a derivative of proline, an amino acid that plays a crucial role in protein synthesis and is involved in various biological processes. This compound is characterized by the presence of a hydroxyl group at the fourth carbon of the proline ring, which contributes to its unique properties and biological activity. It exists as a hydrochloride salt, enhancing its solubility in water, making it suitable for various applications in biochemical research and pharmaceuticals. The trans configuration of the hydroxyl group is significant for its stereochemistry, influencing its interaction with biological systems. Trans-4-Hydroxy-D-proline is often studied for its potential roles in collagen stability and its implications in tissue repair and regeneration. Additionally, it may exhibit antioxidant properties and has been investigated for its effects on cellular processes. As with many amino acid derivatives, it is essential to handle this compound with care, following appropriate safety protocols in laboratory settings.
Formula:C5H10ClNO3
InChI:InChI=1/C5H9NO3.ClH/c7-3-1-4(5(8)9)6-2-3;/h3-4,6-7H,1-2H2,(H,8,9);1H/t3-,4+;/m0./s1
Synonyms:- (4S)-4-Hydroxy-D-proline hydrochloride (1:1)
- D-Proline, 4-hydroxy-, (4S)-, hydrochloride (1:1)
- (2R,4S)-4-hydroxypyrrolidine-2-carboxylic acid hydrochloride
- (2R,4S)-4-Hydroxy-pyrrolidine-2-carboxylic acid hydrochloride
- trans-D-Hpy-OH.HCl
- trans-4-Hydroxy-D-proline Hcl
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
trans-4-Hydroxy-D-proline hydrochloride
CAS:Formula:C5H10ClNO3Purity:97%Color and Shape:SolidMolecular weight:167.5908(2R,4S)-4-Hydroxypyrrolidine-2-carboxylic acid hydrochloride
CAS:(2R,4S)-4-Hydroxypyrrolidine-2-carboxylic acid hydrochloridePurity:97%Color and Shape:SolidMolecular weight:167.59g/moltrans-4-Hydroxy-D-proline hydrochloride
CAS:Formula:C5H10ClNO3Purity:97%Color and Shape:SolidMolecular weight:167.59trans-4-Hydroxy-D-proline hydrochloride
CAS:Please enquire for more information about trans-4-Hydroxy-D-proline hydrochloride including the price, delivery time and more detailed product information at the technical inquiry form on this page
Formula:C5H10ClNO3Purity:Min. 95%Molecular weight:167.59 g/moltans-4-Hydroxy-D-proline hydrochloride
CAS:trans-4-Hydroxy-D-proline hydrochloride, with catalog number T65471 and CAS number 142347-81-7, is a valuable organic compound for life sciences research.Formula:C5H10ClNO3Color and Shape:SolidMolecular weight:167.59




