CAS 14235-54-2
:3-[(2-AMINOETHYL)AMINO]PROPANESULFONIC ACID
Description:
3-[(2-Aminoethyl)amino]propanesulfonic acid, commonly known as taurine, is a sulfonic acid characterized by its amino and sulfonic functional groups. It is a colorless, crystalline solid that is highly soluble in water, making it an important compound in various biological and chemical applications. This substance plays a crucial role in several physiological processes, including bile salt formation, osmoregulation, and neurotransmission. Its zwitterionic nature allows it to act as a stabilizing agent in proteins and membranes. Additionally, taurine is often used in cell culture media and as a supplement in various dietary formulations due to its potential health benefits. The compound is stable under normal conditions but may decompose under extreme pH or temperature. Its CAS number, 14235-54-2, is a unique identifier that facilitates the tracking and regulation of this substance in scientific literature and industry. Overall, taurine is a versatile compound with significant relevance in both biochemistry and pharmacology.
Formula:C5H14N2O3S
InChI:InChI=1/C5H14N2O3S/c6-2-4-7-3-1-5-11(8,9)10/h7H,1-6H2,(H,8,9,10)
SMILES:C(CNCCN)CS(=O)(=O)O
Synonyms:- 3-[(2-Aminoethyl)Amino]Propane-1-Sulfonic Acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
3-[(2-Aminoethyl)amino]propanesulfonicacid Sodium Salt
CAS:Controlled ProductFormula:C5H13N2NaO3SColor and Shape:NeatMolecular weight:204.223

