CAS 142374-19-4
:4-(2-oxoethyl)piperidine-1-carboxylic acid,tert-butyl ester
Description:
4-(2-oxoethyl)piperidine-1-carboxylic acid, tert-butyl ester, is a chemical compound characterized by its piperidine ring structure, which is a six-membered ring containing one nitrogen atom. The presence of a carboxylic acid functional group, along with a tert-butyl ester moiety, contributes to its reactivity and solubility properties. This compound typically exhibits moderate polarity due to the combination of hydrophobic tert-butyl and polar carboxylic acid functionalities. It may be utilized in organic synthesis, particularly in the development of pharmaceuticals or agrochemicals, owing to its potential as an intermediate. The compound's stability can be influenced by factors such as temperature and pH, and it may undergo hydrolysis under certain conditions, releasing the corresponding carboxylic acid. Additionally, its molecular structure suggests potential for hydrogen bonding, which can affect its physical properties, such as boiling and melting points. Overall, this compound is of interest in various chemical applications, particularly in medicinal chemistry.
Formula:C12H21NO3
InChI:InChI=1/C12H21NO3/c1-12(2,3)16-11(15)13-7-4-10(5-8-13)6-9-14/h9-10H,4-8H2,1-3H3
SMILES:CC(C)(C)OC(=O)N1CCC(CC1)CC=O
Synonyms:- N-Boc-4-Piperidineacetaldehyde
- 1-Piperidine Carboxylic Acid, 4-(2-Oxoethyl)-1,1-D
- 1-Boc-4-(2-Oxo-Ethyl)Piperidine
- Tert-Butyl 4-(2-Oxoethyl)Piperidine-1-Carboxylate
- 1-Piperidinecarboxylic Acid,4-(2-Oxoethyl)-,1,1-Dimethylethyl Ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
tert-Butyl 4-(2-Oxoethyl)piperidine-1-carboxylate
CAS:Formula:C12H21NO3Purity:>98.0%(GC)Color and Shape:White to Light yellow powder to crystalMolecular weight:227.304-(2-oxoethyl)piperidine-1-carboxylic acid,tert-butyl ester
CAS:Formula:C12H21NO3Purity:98%Color and Shape:SolidMolecular weight:227.3000Ref: IN-DA003UJV
1g28.00€5g63.00€10g99.00€1kgTo inquire25g192.00€5kgTo inquire100g509.00€250gTo inquire500gTo inquire100mg20.00€250mg24.00€tert-Butyl 4-(2-oxoethyl)piperidine-1-carboxylate
CAS:tert-Butyl 4-(2-oxoethyl)piperidine-1-carboxylateFormula:C12H21NO3Purity:98%Color and Shape: white. crystalline solidMolecular weight:227.30g/molN-Boc-4-Piperidineacetaldehyde
CAS:Formula:C12H21NO3Purity:95.0%Color and Shape:LiquidMolecular weight:227.304N-Boc-4-piperidineacetaldehyde
CAS:N-Boc-4-piperidineacetaldehyde is a chiral, stable, and readily available aldehyde. It has been used in the synthesis of various biologically active molecules including imidazolidinones, which are important for their use as catalysts in organic chemistry. The synthesis of this molecule by the condensation of 4-piperidineacetic acid with acetaldehyde followed by reduction with sodium borohydride is an example of this type of reaction. N-Boc-4-piperidineacetaldehyde can be used to synthesize imines and linkers that are covalently bonded to the protein backbone. This molecule also has conformational stability and is not susceptible to oxidation or radiation damage.
Formula:C12H21NO3Purity:Min. 95%Molecular weight:227.3 g/mol





