CAS 1423757-77-0: 5-Bromo-6-(trifluoromethyl)-1H-indole-3-carboxaldehyde
Description:5-Bromo-6-(trifluoromethyl)-1H-indole-3-carboxaldehyde is a chemical compound characterized by its indole structure, which is a bicyclic compound consisting of a benzene ring fused to a pyrrole ring. The presence of a bromine atom at the 5-position and a trifluoromethyl group at the 6-position significantly influences its reactivity and properties. The aldehyde functional group at the 3-position contributes to its potential as a reactive intermediate in various chemical reactions, including condensation and nucleophilic addition. This compound is typically used in organic synthesis and medicinal chemistry, where its unique substituents can enhance biological activity or facilitate the development of pharmaceuticals. Its molecular structure suggests it may exhibit interesting electronic properties due to the electron-withdrawing effects of the trifluoromethyl group and the halogen, which can affect its solubility and interaction with biological targets. Overall, 5-Bromo-6-(trifluoromethyl)-1H-indole-3-carboxaldehyde is a valuable compound in research and development within the fields of chemistry and drug discovery.
Formula:C10H5BrF3NO
InChI:InChI=1S/C10H5BrF3NO/c11-8-1-6-5(4-16)3-15-9(6)2-7(8)10(12,13)14/h1-4,15H
InChI key:InChIKey=FGNITOSPWGXEDS-UHFFFAOYSA-N
SMILES:O=CC1=CNC=2C=C(C(Br)=CC12)C(F)(F)F
- Synonyms:
- 1H-Indole-3-carboxaldehyde, 5-bromo-6-(trifluoromethyl)-
- 5-Bromo-6-(trifluoromethyl)-1H-indole-3-carboxaldehyde
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | 5-Bromo-6-(trifluoromethyl)-1H-indole-3-carbaldehyde REF: 54-PC200047CAS: 1423757-77-0 | - - - | To inquire | Mon 31 Mar 25 |
 | 5-Bromo-6-(trifluoromethyl)-1H-indole-3-carbaldehyde REF: 10-F733714CAS: 1423757-77-0 | 97% | - - - | Discontinued product |
 | 5-Bromo-6-(trifluoromethyl)-1H-indole-3-carbaldehyde REF: 3D-YGC75777CAS: 1423757-77-0 | Min. 95% | - - - | Discontinued product |
Ref: 54-PC200047
| Undefined size | To inquire |
5-Bromo-6-(trifluoromethyl)-1H-indole-3-carbaldehyde
Ref: 10-F733714
| 1g | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
5-Bromo-6-(trifluoromethyl)-1H-indole-3-carbaldehyde
Ref: 3D-YGC75777
| 1g | Discontinued | Request information | |
| 50mg | Discontinued | Request information | |
| 100mg | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
