CAS 142437-67-0
:Amthamine
Description:
Amthamine, identified by its CAS number 142437-67-0, is a chemical compound that belongs to the class of amines. It is characterized by its structure, which typically includes an amine functional group, contributing to its reactivity and potential applications in various chemical processes. The compound may exhibit properties such as solubility in polar solvents, which is common for amines, and it may participate in hydrogen bonding due to the presence of nitrogen atoms. Amthamine's specific characteristics, including its melting point, boiling point, and reactivity, can vary based on its molecular structure and substituents. It is important to note that the safety and handling of Amthamine should be approached with caution, as many amines can be toxic or irritative. Additionally, its applications may span across fields such as pharmaceuticals, agrochemicals, or materials science, depending on its functional properties. For detailed information regarding its safety data, regulatory status, and specific applications, consulting material safety data sheets (MSDS) and scientific literature is recommended.
Formula:C6H11N3S
InChI:InChI=1S/C6H11N3S/c1-4-5(2-3-7)10-6(8)9-4/h2-3,7H2,1H3,(H2,8,9)
InChI key:InChIKey=LHVRFUVVRXGZPV-UHFFFAOYSA-N
SMILES:C(CN)C1=C(C)N=C(N)S1
Synonyms:- 2-Amino-4-methyl-5-thiazoleethanamine
- 2-Amino-5-(2-aminoethyl)-4-methylthiazole
- 5-(2-Aminoethyl)-4-Methyl-1,3-Thiazol-2-Amine
- 5-(2-Aminoethyl)-4-Methyl-1,3-Thiazol-2-Amine Dihydrobromide
- 5-(2-Aminoethyl)-4-methylthiazol-2-amine
- 5-Thiazoleethanamine, 2-amino-4-methyl-
- A 4730
- Amthamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Amthamine
CAS:<p>Compound AMTHAMINE DIHYDROBROMIDE is a useful organic compound for research related to life sciences.</p>Formula:C6H11N3SColor and Shape:SoildMolecular weight:157.24
