CAS 142451-48-7
:(7E)-2-hydroxy-1-[(1E)-5-hydroxypent-1-en-1-yl]non-7-ene-3,5-diyn-1-yl 6-O-hexopyranosylhexopyranoside
Description:
The chemical substance known as (7E)-2-hydroxy-1-[(1E)-5-hydroxypent-1-en-1-yl]non-7-ene-3,5-diyn-1-yl 6-O-hexopyranosylhexopyranoside, with the CAS number 142451-48-7, is a complex glycoside characterized by its unique structural features. This compound contains multiple functional groups, including hydroxyl (-OH) groups and a glycosidic linkage, which contribute to its solubility and reactivity. The presence of a non-ene and diynyl moiety suggests potential for conjugation and interaction with various biological systems. Its glycosidic nature indicates that it may exhibit properties typical of carbohydrates, such as sweetness or potential for fermentation. The stereochemistry, denoted by the (E) and (Z) configurations, plays a crucial role in determining the compound's biological activity and interaction with enzymes or receptors. Overall, this substance may have applications in pharmaceuticals or biochemistry, particularly in studies related to glycosylation and the role of complex carbohydrates in biological processes. Further research would be necessary to elucidate its specific properties and potential uses.
Formula:C26H38O13
InChI:InChI=1/C26H38O13/c1-2-3-4-5-7-10-15(29)16(11-8-6-9-12-27)37-26-24(35)22(33)20(31)18(39-26)14-36-25-23(34)21(32)19(30)17(13-28)38-25/h2-3,8,11,15-35H,6,9,12-14H2,1H3/b3-2+,11-8+
Synonyms:- 2-Hydroxy-1-(5-hydroxy-1-pentenyl)-7-nonene-3,5-diynyl 6-O-hexopyranosylhexopyranoside
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Lobetyolinin
CAS:<p>Lobetyolinin is a compound from Codonopsis pilosula with acetylcholinesterase (AChE) inhibitory and antiarrhythmic activities.</p>Formula:C26H38O13Purity:99.72%Color and Shape:SolidMolecular weight:558.57Lobetyolinin
CAS:<p>Lobetyolinin is a natural alkaloid, which is a bioactive compound extracted from certain plant species, particularly those belonging to the Lobelia genus. Alkaloids are known for their diverse pharmacological effects and are sourced primarily from plant materials. In terms of mode of action, lobetyolinin functions by interacting with specific receptors and signaling pathways within biological systems, which can lead to a range of physiological responses.</p>Formula:C26H38O13Purity:Min. 95%Molecular weight:558.6 g/mol





