CAS 14248-66-9
:Pyridine, 3,5-dimethyl-4-nitro-, 1-oxide
Description:
Pyridine, 3,5-dimethyl-4-nitro-, 1-oxide, also known by its CAS number 14248-66-9, is a heterocyclic organic compound characterized by a pyridine ring with specific substituents. This compound features a nitro group and two methyl groups attached to the pyridine ring, which influence its chemical reactivity and physical properties. It is typically a yellow to brown solid at room temperature and is soluble in organic solvents. The presence of the nitro group contributes to its potential as an electron-withdrawing group, affecting its reactivity in various chemical reactions, such as electrophilic substitutions. Additionally, the methyl groups can provide steric hindrance, influencing the compound's behavior in chemical processes. Pyridine derivatives are often used in the synthesis of pharmaceuticals, agrochemicals, and as intermediates in organic synthesis. Safety data indicates that it should be handled with care due to potential toxicity and environmental hazards. Overall, this compound exemplifies the diverse chemistry associated with substituted pyridines.
Formula:C7H8N2O3
InChI:InChI=1S/C7H8N2O3/c1-5-3-8(10)4-6(2)7(5)9(11)12/h3-4H,1-2H3
InChI key:InChIKey=VLKVMXPKEDVNBO-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C(C)=CN(=O)=CC1C
Synonyms:- 1-(2,4-Dihydroxyphenyl)Propan-1-One
- 3,5-Dimethyl-4-Nitropyridine-N-Oxide
- 3,5-Dimethyl-4-nitro-1-oxidopyridin-1-ium
- 3,5-Lutidine, 4-nitro-, 1-oxide
- 4-Nitro-3,5-dimethylpyridine 1-oxide
- NSC 63056
- Pyridine, 3,5-dimethyl-4-nitro-, 1-oxide
- 3,5-Dimethyl-4-nitropyridine 1-oxide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Pyridine,3,5-dimethyl-4-nitro-, 1-oxide
CAS:Formula:C7H8N2O3Purity:95%Color and Shape:SolidMolecular weight:168.15003,5-Dimethyl-4-nitropyridine 1-oxide
CAS:3,5-Dimethyl-4-nitropyridine 1-oxidePurity:95%Molecular weight:168.15g/molEsomeprazole Impurity 45 (4-Nitro-3, 5-Dimethylpyridine N-oxide)
CAS:Formula:C7H8N2O3Color and Shape:Pale Yellow SolidMolecular weight:168.153,5-Dimethyl-4-nitropyridine 1-Oxide
CAS:Applications 3,5-Dimethyl-4-nitropyridine 1-Oxide is an intermediate used to prepare 2-[(2-pyridylmethyl)thio or -sulfinyl]benzimidazoles as antiulcer agents.
References Nohara, A., et al.: U.S., US 4689333 A 19870825. (1987)Formula:C7H8N2O3Color and Shape:Off White SolidMolecular weight:168.53,5-Dimethyl-4-nitropyridine 1-oxide
CAS:3,5-Dimethyl-4-nitropyridine 1-oxide is a nitro compound with the chemical formula CHNO. It is an organic compound that has been shown to be carcinogenic in animal studies and has caused cancer in humans. 3,5-Dimethyl-4-nitropyridine 1-oxide can be found in the environment as a result of industrial accidents or environmental pollution. It is found in building materials such as acetonitrile and organic solvents. This compound is not soluble in water, which limits its potential for environmental transport.Formula:C7H8N2O3Purity:Min. 95%Color and Shape:PowderMolecular weight:168.15 g/mol3,5-Dimethyl-4-nitropyridine 1-oxide
CAS:3,5-Dimethyl-4-nitropyridine 1-oxide is a useful organic compound for research related to life sciences. The catalog number is T67494 and the CAS number is 14248-66-9.Formula:C7H8N2O3Color and Shape:SolidMolecular weight:168.152







