CAS 142492-01-1
:N-METHYL-N-METHOXYDIFLUOROACETAMIDE
Description:
N-Methyl-N-methoxydifluoroacetamide is a chemical compound characterized by its unique structure, which includes a methyl group, a methoxy group, and two fluorine atoms attached to an acetamide backbone. This compound is typically a colorless to pale yellow liquid with a moderate boiling point and is soluble in organic solvents. The presence of the difluoromethyl group imparts distinctive reactivity, making it useful in various chemical synthesis applications, particularly in the pharmaceutical and agrochemical industries. Its molecular structure suggests potential for hydrogen bonding due to the amide functional group, which can influence its physical properties and reactivity. Additionally, the fluorine atoms contribute to its lipophilicity and may enhance biological activity. Safety data indicates that, like many fluorinated compounds, it should be handled with care due to potential toxicity and environmental concerns. Overall, N-Methyl-N-methoxydifluoroacetamide is a versatile compound with applications in synthetic chemistry and material science.
Formula:C4H7F2NO2
InChI:InChI=1/C4H7F2NO2/c1-7(9-2)4(8)3(5)6/h3H,1-2H3
SMILES:CN(C(=O)C(F)F)OC
Synonyms:- 2,2-Difluoro-N-Methoxy-N-Methylacetamide
- N-Methoxy-N-Methyldifluoroacetamide
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
2,2-Difluoro-N-methoxy-N-methylacetamide, 95%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo SciFormula:C4H7F2NO2Purity:95%Color and Shape:Clear colorless to yellow or orange to brown, LiquidMolecular weight:139.102,2-Difluoro-N-methoxy-N-methylacetamide
CAS:Formula:C4H7F2NO2Purity:95%Color and Shape:LiquidMolecular weight:139.10072,2-Difluoro-N-methoxy-N-methylacetamide
CAS:2,2-Difluoro-N-methoxy-N-methylacetamideFormula:C4H7F2NO2Purity:95%Color and Shape: clear. colourless liquidMolecular weight:139.10g/molN-Methoxy-N-methyldifluoroacetamide
CAS:Purity:98.0%Color and Shape:LiquidMolecular weight:139.1020050048828



