CAS 14251-72-0
:BUTYLTRIMETHYLAMMONIUM CHLORIDE
Description:
Butyltrimethylammonium chloride, with the CAS number 14251-72-0, is a quaternary ammonium compound characterized by its cationic nature. It consists of a butyl group attached to a nitrogen atom that is further bonded to three methyl groups, making it a trialkylammonium salt. This compound is typically a white crystalline solid or a colorless liquid, depending on its purity and form. It is soluble in water and various organic solvents, which enhances its utility in different applications. Butyltrimethylammonium chloride exhibits surfactant properties, making it useful in formulations for detergents, emulsifiers, and disinfectants. Additionally, it can serve as a phase transfer catalyst in organic synthesis, facilitating the transfer of reactants between immiscible phases. Its cationic nature allows it to interact with anionic species, which can be advantageous in various chemical processes. However, like many quaternary ammonium compounds, it may pose environmental and health risks, necessitating careful handling and disposal.
Formula:C7H18ClN
InChI:InChI=1/C7H17N/c1-4-5-6-7-8(2)3/h4-7H2,1-3H3/p+1
InChI key:InChIKey=WJVGUJSDVKTDIX-UHFFFAOYSA-M
SMILES:C([N+](C)(C)C)CCC.[Cl-]
Synonyms:- 1-Butanaminium, N,N,N-trimethyl-, chloride
- 1-Butanaminium, N,N,N-trimethyl-, chloride (1:1)
- Ammonium, butyltrimethyl-, chloride
- N,N,N-trimethylbutan-1-aminium chloride
- N,N-dimethylpentan-1-aminium
- N-Butyl-N,N,N-trimethylammonium chloride
- Trimethylbutylammonium chloride
- Butyltrimethylammonium chloride
- Butyltrimethylammonium chloride
- Butyltrimethylaminiumchloride
- Butyltrimethylaminium·chloride
- butyl(trimethyl)azanium,chloride
- N,N,N-TriMethyl-1-butanaMiniuM Chloride
- N,N,N-triMet
- TriMethyButylAmmonium Chloride
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
N,N,N-Trimethylbutan-1-aminium chloride
CAS:Formula:C7H18ClNPurity:97%Color and Shape:SolidMolecular weight:151.6775N,N,N-Trimethylbutan-1-Aminium Chloride
CAS:N,N,N-Trimethylbutan-1-Aminium ChloridePurity:98%Molecular weight:151.68g/molButyltrimethylammonium Chloride
CAS:Controlled ProductApplications Butyltrimethylammonium Chloride is an antistatic agents that is used in surface application on polymers. Butyltrimethylammonium Chloride is also used as a co-pyrolisant in acetylcholine and choline pyrolysis gas chromatography.
References Vasilenok, Y.I. et al.: Vest. Akad. Nav. BSSR Ser. Khim. Nav., 5, 97 (1971); Vasilenok, Y.I. et al.: Dok. Akad. Nauk BSSR, 18, 1016 (1984): Khandelwal, J.K. et al.: Eur. J. Pharmacol., 76, 145 (1981);Formula:C7H18ClNColor and Shape:NeatMolecular weight:151.68N,N,N-Trimethylbutan-1-aminium chloride
CAS:Formula:C7H18ClNPurity:97%Color and Shape:SolidMolecular weight:151.68



