CAS 142523-14-6

1-[(4-HYDROXYPHENOXY)ETHYLIDENE]BIS[PHOSPHINYLIDYNEBIS(OXYMETHYLENE)]-2,2-DIMETHYLPROPANOATE

Description:

1-[(4-Hydroxyphenoxy)ethylidene]bis[phosphinylidynebis(oxymethylene)]-2,2-dimethylpropanoate, with CAS number 142523-14-6, is a complex organic compound characterized by its unique structural features, which include a phosphinylidyne moiety and a hydroxyphenoxy group. This compound is likely to exhibit properties typical of phosphorous-containing compounds, such as potential applications in coordination chemistry or as a ligand in metal complexes. The presence of the hydroxyphenoxy group suggests that it may have antioxidant properties or could participate in hydrogen bonding interactions. Additionally, the dimethylpropanoate group indicates that it may possess ester characteristics, which could influence its solubility and reactivity. The compound's intricate structure may also suggest potential uses in pharmaceuticals, agrochemicals, or materials science, particularly in the development of functionalized polymers or as intermediates in organic synthesis. Overall, the specific characteristics and applications of this compound would depend on its reactivity and interactions with other chemical species.

Formula: C₃₂H₅₂O₁₆P₂

InChI: InChI=1/C29H47O16P2/c1-24(2,3)20(31)41-29(42-21(32)25(4,5)6,43-22(33)26(7,8)9,44-23(34)27(10,11)12)45-47(38,39)28(13,46(35,36)37)40-19-16-14-18(30)15-17-19/h14-17,30H,1-13H3,(H,38,39)(H2,35,36,37)

SMILES: CC(C)(C)C(=O)OC(OC(=O)C(C)(C)C)(OC(=O)C(C)(C)C)(OC(=O)C(C)(C)C)OP(=O)(C(C)(Oc1ccc(cc1)O)P(=O)(O)O)O

Synonyms:

• L-690,488

L-690488

CAS: 142523-14-6

L-690488 has more effective cell penetration than L-690330. L-690488 is a prodrug of L-690330 and is a selective inositol monophosphatase (IMPase) inhibitor.

Formula: C₃₂H₅₂O₁₆P₂

Purity: 98%

Color and Shape: Solid

Molecular weight: 754.69

Ref: TM-T11797