CAS 142523-38-4

L-690,330

Description:

L-690,330, with the CAS number 142523-38-4, is a chemical compound known for its role as a selective inhibitor of the enzyme protein kinase C (PKC). This compound is characterized by its ability to modulate various cellular processes, including cell growth, differentiation, and apoptosis, making it of interest in pharmacological research. L-690,330 exhibits a specific binding affinity for certain PKC isoforms, which allows for targeted therapeutic applications, particularly in cancer research and treatment. Its chemical structure includes functional groups that contribute to its inhibitory activity, and it is typically studied in vitro to assess its efficacy and safety profile. As with many kinase inhibitors, understanding its mechanism of action and potential side effects is crucial for developing effective therapeutic strategies. Overall, L-690,330 represents a valuable tool in the exploration of PKC-related pathways in various biological contexts.

Formula: C₈H₁₂O₈P₂

InChI: InChI=1/C8H12O8P2/c1-8(17(10,11)12,18(13,14)15)16-7-4-2-6(9)3-5-7/h2-5,9H,1H3,(H2,10,11,12)(H2,13,14,15)

SMILES: CC(Oc1ccc(cc1)O)(P(=O)(O)O)P(=O)(O)O

Synonyms:

• [1-(4-Hydroxyphenoxy)Ethylidene]Bisphosphonic Acid
• [1-(4-Hydroxyphenoxy)Ethane-1,1-Diyl]Bis(Phosphonic Acid)
• L-690,330
• Phosphonic acid, P,P'-[1-(4-hydroxyphenoxy)ethylidene]bis-

L-690330

CAS: 142523-38-4

L-690330 inhibits human/bovine inositol monophosphatase; Ki: 0.19-0.42 μM. 10x potency vs. mouse/rat IMPase.

Formula: C₈H₁₂O₈P₂

Color and Shape: Solid

Molecular weight: 298.12

Ref: TM-T15685

L 690330

CAS: 142523-38-4

Inositol monophosphatase (IMPase) inhibitor

Formula: C₈H₁₂O₈P₂

Purity: Min. 95%

Molecular weight: 298.12 g/mol

Ref: 3D-BL176912