
CAS 1425366-60-4
:4-Piperidinone, 3-(2-chlorophenyl)-, hydrochloride (1:1)
Description:
4-Piperidinone, 3-(2-chlorophenyl)-, hydrochloride (1:1) is a chemical compound characterized by its piperidinone structure, which includes a piperidine ring with a ketone functional group and a chlorophenyl substituent. This compound typically appears as a white to off-white crystalline solid and is soluble in water and various organic solvents, reflecting its hydrochloride salt form. The presence of the 2-chlorophenyl group contributes to its potential biological activity, making it of interest in medicinal chemistry and pharmacological research. The hydrochloride salt enhances its stability and solubility, facilitating its use in various applications, including drug formulation. As with many piperidine derivatives, it may exhibit properties such as analgesic, anti-inflammatory, or psychoactive effects, depending on its specific interactions with biological targets. Safety and handling precautions are essential, as with all chemical substances, to mitigate any potential hazards associated with its use.
Formula:C11H12ClNO·ClH
InChI:InChI=1S/C11H12ClNO.ClH/c12-10-4-2-1-3-8(10)9-7-13-6-5-11(9)14;/h1-4,9,13H,5-7H2;1H
InChI key:InChIKey=AXJMGSQRUFSIAN-UHFFFAOYSA-N
SMILES:ClC1=C(C=CC=C1)C2C(=O)CCNC2.Cl
Synonyms:- 4-Piperidinone, 3-(2-chlorophenyl)-, hydrochloride (1:1)
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
3-(2-Chlorophenyl)-4-piperidinone Hydrochloride
CAS:Controlled ProductFormula:C11H12ClNO·HClColor and Shape:NeatMolecular weight:246.133
