CAS 14255-87-9: Parbendazole
Description:Parbendazole is a benzimidazole derivative primarily used as an anthelmintic agent, effective against a variety of parasitic worms. It is characterized by its broad-spectrum activity, making it valuable in veterinary medicine for treating infections in livestock. The chemical structure of parbendazole features a benzimidazole core, which is crucial for its mechanism of action, as it disrupts the microtubule formation in parasites, leading to their immobilization and death. Parbendazole is typically administered orally and is known for its relatively low toxicity in target animals. Its solubility profile indicates that it is more soluble in organic solvents than in water, which can influence its bioavailability and absorption. Additionally, parbendazole is often studied for its potential effects on human health, particularly in relation to its metabolites and environmental impact. As with many pharmaceuticals, proper handling and dosage are essential to maximize efficacy while minimizing adverse effects.
Formula:C13H17N3O2
InChI:InChI=1S/C13H17N3O2/c1-3-4-5-9-6-7-10-11(8-9)15-12(14-10)16-13(17)18-2/h6-8H,3-5H2,1-2H3,(H2,14,15,16,17)
InChI key:InChIKey=YRWLZFXJFBZBEY-UHFFFAOYSA-N
SMILES:O=C(OC)NC1=NC=2C=C(C=CC2N1)CCCC
- Synonyms:
- 2-Benzimidazolecarbamic acid, 5-butyl-, methyl ester
- 5-Butyl-2-(carbomethoxyamino)benzimidazole
- Carbamic acid, (5-butyl-1H-benzimidazol-2-yl)-, methyl ester
- Carbamic acid, N-(6-butyl-1H-benzimidazol-2-yl)-, methyl ester
- Helatac
- Helmatac
- Methyl (5-butyl-1H-benzimidazol-2-yl)carbamate
- Methyl 5(6)-butyl-2-benzimidazolecarbamate
- Methyl 5-butylbenzimidazole-2-carbamate
- PBZ (fungicide)
- See more synonyms
- Skf 29044
- methyl (6-butyl-1H-benzimidazol-2-yl)carbamate
- methyl N-(5-butyl-3H-benzoimidazol-2-yl)carbamate
- Parbendazole