CymitQuimica logo

CAS 14256-69-0

:

1,2-Ethanediamine, N-cyclohexyl-N-methyl-

Description:
1,2-Ethanediamine, N-cyclohexyl-N-methyl- is an organic compound characterized by its amine functional groups, specifically featuring two amine (-NH2) groups attached to a two-carbon ethane backbone, with a cyclohexyl and a methyl group substituent. This compound is typically a colorless to pale yellow liquid with a distinct amine odor. It is soluble in water and organic solvents, which enhances its utility in various chemical applications. The presence of both cyclohexyl and methyl groups contributes to its hydrophobic characteristics, influencing its reactivity and interaction with other substances. As a diamine, it can participate in various chemical reactions, including those involving nucleophilic substitution and polymerization, making it valuable in the synthesis of polymers, surfactants, and other chemical intermediates. Safety considerations include its potential to cause irritation upon contact with skin or eyes, and appropriate handling measures should be taken to mitigate exposure. Overall, this compound is significant in both industrial and research settings due to its versatile chemical properties.
Formula:C9H20N2
InChI:InChI=1S/C9H20N2/c1-11(8-7-10)9-5-3-2-4-6-9/h9H,2-8,10H2,1H3
InChI key:FNZNHTIBNDAHFH-UHFFFAOYSA-N
SMILES:CN(CCN)C1CCCCC1
Found 2 products.