CAS 142561-10-2

Glyasperin D

Description:

Glyasperin D, with the CAS number 142561-10-2, is a naturally occurring compound classified as a flavonoid glycoside. It is primarily derived from various plant sources, particularly those belonging to the genus Glycyrrhiza, which is known for its medicinal properties. This compound exhibits a range of biological activities, including antioxidant, anti-inflammatory, and potential anticancer effects, making it of interest in pharmacological research. Glyasperin D is characterized by its specific structural features, including a flavonoid backbone and sugar moieties, which contribute to its solubility and bioactivity. Its presence in herbal formulations highlights its significance in traditional medicine, particularly in treating ailments related to inflammation and oxidative stress. Additionally, ongoing studies are exploring its mechanisms of action and potential therapeutic applications, underscoring the importance of glycosylated flavonoids in drug development and natural product chemistry.

Formula: C₂₂H₂₆O₅

InChI: InChI=1S/C22H26O5/c1-13(2)5-7-17-20(25-3)11-21-18(22(17)26-4)9-14(12-27-21)16-8-6-15(23)10-19(16)24/h5-6,8,10-11,14,23-24H,7,9,12H2,1-4H3/t14-/m0/s1

InChI key: InChIKey=DDMAUIOCNQXFHL-AWEZNQCLSA-N

SMILES: O(C)C1=C2C(=CC(OC)=C1CC=C(C)C)OC[C@H](C2)C3=C(O)C=C(O)C=C3

Synonyms:

• 1,3-Benzenediol, 4-[(3R)-3,4-dihydro-5,7-dimethoxy-6-(3-methyl-2-butenyl)-2H-1-benzopyran-3-yl]-
• 1,3-Benzenediol, 4-[(3R)-3,4-dihydro-5,7-dimethoxy-6-(3-methyl-2-buten-1-yl)-2H-1-benzopyran-3-yl]-
• Glyasperin D
• 1,3-Benzenediol, 4-[3,4-dihydro-5,7-dimethoxy-6-(3-methyl-2-butenyl)-2H-1-benzopyran-3-yl]-, (R)-
• 4-[(3R)-3,4-Dihydro-5,7-dimethoxy-6-(3-methyl-2-buten-1-yl)-2H-1-benzopyran-3-yl]-1,3-benzenediol

Glyasperin D

CAS: 142561-10-2

Formula: C₂₂H₂₆O₅

Purity: 97.5%

Molecular weight: 370.4388

Ref: IN-DA009VUH

Glyasperin D

CAS: 142561-10-2

Glyasperin D is a flavonoid compound extracted from the root of Glycyrrhiza uralensis, which has potential antimicrobial activity against Helicobacter pylori.

Formula: C₂₂H₂₆O₅

Purity: 98%

Color and Shape: Solid

Molecular weight: 370.44

Ref: TM-TN1699

Glyasperin D

CAS: 142561-10-2

Formula: C₂₂H₂₆O₅

Purity: 95%~99%

Molecular weight: 370.445

Ref: BP-SBP03724

Glyasperin D

CAS: 142561-10-2

Glyasperin D is a synthetic compound, which is a structurally engineered molecule designed to interfere with specific bacterial biosynthetic pathways. It originates from a laboratory synthesis that utilizes advanced organic chemistry techniques to create a stable and potent molecular structure with antimicrobial properties. The mode of action involves the targeted inhibition of key enzymes in bacterial metabolism, disrupting essential cellular processes and leading to the reduction of bacterial growth or elimination of pathogenic bacteria.

Formula: C₂₂H₂₆O₅

Purity: Min. 95%

Molecular weight: 370.4 g/mol

Ref: 3D-SFA56110