CymitQuimica logo

CAS 14257-40-0

:

acetochloro-A-D-mannose

Description:
Acetochloro-A-D-mannose, with the CAS number 14257-40-0, is a chemical compound that belongs to the class of monosaccharides, specifically a derivative of mannose. This compound features a chlorinated acetyl group, which contributes to its reactivity and potential applications in organic synthesis. The presence of the acetyl group indicates that it may participate in acylation reactions, while the chlorine atom can enhance its electrophilic character, making it useful in various chemical transformations. Acetochloro-A-D-mannose is typically characterized by its crystalline structure and may exhibit solubility in polar solvents due to the hydroxyl groups present in its structure. Its reactivity and functional groups make it a valuable intermediate in the synthesis of more complex carbohydrates or pharmaceutical compounds. As with many chlorinated organic compounds, it is essential to handle acetochloro-A-D-mannose with care, considering potential toxicity and environmental impact. Overall, its unique structural features provide a basis for its utility in chemical research and applications.
Formula:C14H19ClO9
InChI:InChI=1/C14H19ClO9/c1-6(16)20-5-10-11(21-7(2)17)12(22-8(3)18)13(14(15)24-10)23-9(4)19/h10-14H,5H2,1-4H3/t10-,11-,12-,13-,14-/m0/s1
InChI key:BYWPSIUIJNAJDV-DGTMBMJNSA-N
SMILES:CC(=O)OC[C@H]1[C@@H]([C@@H]([C@@H]([C@@H](Cl)O1)OC(=O)C)OC(=O)C)OC(=O)C
Synonyms:
  • Chloro 2,3,4,6-Tetra-O-Acetyl-a-D-Mannopyranoside
  • [(2R,3S,4S,5S,6S)-4,5-diacetoxy-6-(acetoxymethyl)-2-chloro-tetrahydropyran-3-yl] acetate
  • 6-Chloro-6-Deoxy-D-Mannose
Found 3 products.