CAS 14257-69-3
:β-D-Glucosamine
Description:
β-D-Glucosamine is an amino sugar that plays a crucial role in various biological processes. It is an isomer of glucosamine, specifically the β-anomer, which means that the amino group is positioned on the same side as the hydroxyl group on the first carbon of the glucose molecule. This compound is characterized by its white crystalline appearance and is soluble in water, making it readily available for biological interactions. β-D-Glucosamine is a key component of glycosaminoglycans and glycoproteins, contributing to the structural integrity of cartilage and connective tissues. It is often used in dietary supplements aimed at supporting joint health and may have anti-inflammatory properties. Additionally, it is involved in the synthesis of chitin, a vital structural polysaccharide in the exoskeletons of arthropods and the cell walls of fungi. Its chemical formula is C6H13NO5, and it has a molecular weight that reflects its composition of carbon, hydrogen, nitrogen, and oxygen. Overall, β-D-Glucosamine is significant in both health applications and biological research.
Formula:C6H13NO5
InChI:InChI=1S/C6H13NO5/c7-3-5(10)4(9)2(1-8)12-6(3)11/h2-6,8-11H,1,7H2/t2-,3-,4-,5-,6-/m1/s1
InChI key:InChIKey=MSWZFWKMSRAUBD-QZABAPFNSA-N
SMILES:C(O)[C@@H]1[C@@H](O)[C@H](O)[C@@H](N)[C@H](O)O1
Synonyms:- 2-Amino-2-deoxy-β-D-glucopyranose
- β-Glucosamine
- β-D-Glucosamine
- β-D-Glucopyranose, 2-amino-2-deoxy-
- Glucopyranose, 2-amino-2-deoxy-, β-D-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
