CymitQuimica logo

CAS 14258-43-6

:

2,2′-[1,4-Piperazinediylbis(2,1-ethanediyloxy)]bis[ethanol]

Description:
2,2′-[1,4-Piperazinediylbis(2,1-ethanediyloxy)]bis[ethanol], identified by its CAS number 14258-43-6, is a chemical compound characterized by its complex structure that includes a piperazine moiety and multiple ethylene glycol units. This compound typically exhibits properties such as solubility in polar solvents due to the presence of hydroxyl (-OH) groups, which enhance its hydrophilicity. The piperazine ring contributes to its potential as a ligand in coordination chemistry and may also impart biological activity, making it of interest in pharmaceutical applications. Its structure suggests that it could engage in hydrogen bonding, influencing its physical properties like melting and boiling points. Additionally, the presence of multiple functional groups allows for versatility in chemical reactivity, making it suitable for various synthetic pathways. Overall, this compound's unique characteristics stem from its intricate arrangement of functional groups, which can lead to diverse applications in both industrial and research settings.
Formula:C12H26N2O4
InChI:InChI=1S/C12H26N2O4/c15-7-11-17-9-5-13-1-2-14(4-3-13)6-10-18-12-8-16/h15-16H,1-12H2
InChI key:InChIKey=XDPJQAWSYBMPOJ-UHFFFAOYSA-N
SMILES:C(COCCO)N1CCN(CCOCCO)CC1
Synonyms:
  • Ethanol, 2,2′-[1,4-piperazinediylbis(ethyleneoxy)]di-
  • Ethanol, 2,2′-[1,4-piperazinediylbis(2,1-ethanediyloxy)]bis-
  • 2,2′-[1,4-Piperazinediylbis(2,1-ethanediyloxy)]bis[ethanol]
  • N,N′-Bis(hydroxyethoxyethyl)piperazine
  • 2,2′-((Piperazine-1,4-diylbis(ethane-2,1-diyl))bis(oxy))diethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.