CymitQuimica logo

CAS 1425932-06-4

:

5-(3-Oxetanyl)-1H-pyrazol-3-amine

Description:
5-(3-Oxetanyl)-1H-pyrazol-3-amine is a chemical compound characterized by its unique structural features, which include a pyrazole ring and an oxetane moiety. The pyrazole ring is a five-membered aromatic heterocycle containing two nitrogen atoms, contributing to the compound's potential biological activity. The presence of the oxetane group, a four-membered cyclic ether, adds to the compound's reactivity and may influence its interaction with biological targets. This compound is likely to exhibit properties such as solubility in polar solvents, moderate stability under standard conditions, and potential for hydrogen bonding due to the amine functional group. Its specific applications may vary, but compounds with similar structures are often explored in medicinal chemistry for their potential therapeutic effects. The compound's CAS number, 1425932-06-4, allows for easy identification and retrieval of data related to its synthesis, properties, and potential uses in research and industry. Overall, 5-(3-Oxetanyl)-1H-pyrazol-3-amine represents a class of compounds that may hold promise in various chemical and pharmaceutical applications.
Formula:C6H9N3O
InChI:InChI=1S/C6H9N3O/c7-6-1-5(8-9-6)4-2-10-3-4/h1,4H,2-3H2,(H3,7,8,9)
InChI key:InChIKey=HTXKPXNKAIVWDW-UHFFFAOYSA-N
SMILES:NC=1C=C(NN1)C2COC2
Synonyms:
  • 5-(3-Oxetanyl)-1H-pyrazol-3-amine
  • 1H-Pyrazol-3-amine, 5-(3-oxetanyl)-
Found 0 products.