CymitQuimica logo

CAS 1426-54-6

:

Phenol, 4-fluoro-2-[(4-methoxyphenyl)methyl]-

Description:
Phenol, 4-fluoro-2-[(4-methoxyphenyl)methyl]- is an organic compound characterized by its phenolic structure, which includes a hydroxyl group (-OH) attached to a benzene ring. The presence of a fluorine atom at the para position relative to the hydroxyl group and a methoxy group (-OCH3) on another phenyl ring contributes to its unique chemical properties. This compound is typically a white to light yellow solid and is known for its moderate solubility in organic solvents. It exhibits both acidic and basic properties due to the hydroxyl group, allowing it to participate in various chemical reactions, including electrophilic aromatic substitution. The methoxy group can influence the electron density of the aromatic system, affecting reactivity and stability. Additionally, the compound may exhibit biological activity, making it of interest in pharmaceutical research. Safety precautions should be taken when handling this substance, as phenolic compounds can be toxic and irritant.
Formula:C14H13FO2
InChI:InChI=1S/C14H13FO2/c1-17-13-5-2-10(3-6-13)8-11-9-12(15)4-7-14(11)16/h2-7,9,16H,8H2,1H3
InChI key:IMXDWZHGVUZVOW-UHFFFAOYSA-N
SMILES:COC1=CC=C(C=C1)CC2=C(C=CC(=C2)F)O
Found 2 products.