CAS 14260-82-3
:3'-DEOXY-3'-IODOTHYMIDINE
Description:
3'-Deoxy-3'-iodothymidine, commonly referred to as Iodo-deoxy-thymidine (IdT), is a nucleoside analog of thymidine where the hydroxyl group at the 3' position of the sugar moiety is replaced by an iodine atom. This modification imparts unique properties to the compound, making it of interest in biochemical and pharmaceutical research, particularly in the study of antiviral agents and cancer therapies. IdT is characterized by its ability to interfere with DNA synthesis, as it can be incorporated into DNA strands during replication, potentially leading to chain termination. The presence of the iodine atom can also enhance the compound's stability and alter its interaction with enzymes involved in nucleic acid metabolism. IdT is typically studied for its effects on viral replication and its potential as a therapeutic agent against certain viral infections. Additionally, its structural characteristics allow for various modifications that can enhance its biological activity or selectivity. As with many nucleoside analogs, the pharmacokinetics and toxicity profiles are important considerations in its application.
Formula:C10H13IN2O4
InChI:InChI=1/C10H13IN2O4/c1-5-3-13(10(16)12-9(5)15)8-2-6(11)7(4-14)17-8/h3,6-8,14H,2,4H2,1H3,(H,12,15,16)/t6-,7+,8+/m0/s1
Synonyms:- Thymidine, 3'-Deoxy-3'-Iodo
- 3'-Iodothymidine
- 3'-Iodo-3'-deoxy-D-thymidine
- 1-[(2S,4R,5R)-4-(hydroxymethyl)-5-iodotetrahydrofuran-2-yl]-5-methylpyrimidine-2,4(1H,3H)-dione
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
3'-Deoxy-3'-iodothymidine
CAS:3'-Deoxy-3'-iodothymidine is a Nucleoside Derivative - Halo-nucleoside, 2',3'-Dideoxy nucleoside.Formula:C10H13IN2O4Color and Shape:SolidMolecular weight:352.13Ref: TM-TNU1049
5mgTo inquire10mgTo inquire25mgTo inquire50mgTo inquire100mgTo inquire500mgTo inquire3'-Deoxy-3'-iodothymidine
CAS:3'-Deoxy-3'-iodothymidine is a nucleoside that is found in DNA. It has a constant of -1.5 and can be protonated to form the anion. The molecule has a reactive radical anion, which is stabilized by electron delocalization with the aromatic rings. 3'-Deoxy-3'-iodothymidine has been studied for use as a medicine for cancer treatment, but it also has applications in biology and chemistry. This compound can be used in conductometry and electron spectroscopy, as well as other chemical experiments that require ionic compounds or radiation.
Formula:C10H13IN2O4Purity:Min. 95%Color and Shape:PowderMolecular weight:352.13 g/mol


