CAS 14262-60-3: DIBENZO-15-CROWN-5
Description:Dibenzo-15-crown-5 is a member of the crown ether family, characterized by its ability to selectively bind cations due to its unique molecular structure. It consists of a cyclic polyether with a crown-like shape, featuring a central cavity that can accommodate various metal ions, particularly alkali and alkaline earth metals. The "15" in its name indicates that the molecule contains 15 atoms in its ring, which includes both oxygen and carbon atoms. This compound is known for its high solubility in organic solvents and its relatively low solubility in water, making it useful in various applications, including ion-selective electrodes and extraction processes. Dibenzo-15-crown-5 exhibits strong complexation properties, which can be influenced by the size and charge of the cation it interacts with. Additionally, it has potential applications in supramolecular chemistry and materials science, where it can facilitate the design of molecular sensors and catalysts. Its ability to form stable complexes with specific ions makes it a valuable tool in analytical chemistry and separation techniques.
Formula:C18H20O5
InChI:InChI=1/C18H20O5/c1-3-7-17-15(5-1)20-11-9-19-10-12-21-16-6-2-4-8-18(16)23-14-13-22-17/h1-8H,9-14H2
- Synonyms:
- Dibenzo-15-Crown 5-Ether
- 6,7,9,10,17,18-Hexahydrodibenzo[B,H][1,4,7,10,13]Pentaoxacyclopentadecin
- 6,7,9,10,17,18-Hexahydrodibenzo[B,H][1,4,7,10,13]Pentaoxacyclopentadecine
| Brand | Product data | Purity | Price range | Estimated delivery |
|---|---|---|---|---|
 | Dibenzo-15-crown 5-Ether REF: 3B-D2877CAS: 14262-60-3 | >95.0%(GC) | 188.00 € | Mon 28 Apr 25 |
 | 6,7,9,10,12,13-Hexahydrodibenzo[b,e][1,4,7,10,13]pentaoxacyclopentadecine REF: IN-DA003PBJCAS: 14262-60-3 | 95% | To inquire | Mon 05 May 25 |
 | Dibenzo-15-crown 5-ether REF: 54-OR72916CAS: 14262-60-3 | - - - | 399.00 € | Tue 06 May 25 |
 | Dibenzo-15-crown 5-Ether REF: 3D-FD62084CAS: 14262-60-3 | Min. 95% | - - - | Discontinued product |
Dibenzo-15-crown 5-Ether
Ref: 3B-D2877
| 1g | 188.00 € |
![6,7,9,10,12,13-Hexahydrodibenzo[b,e][1,4,7,10,13]pentaoxacyclopentadecine](https://static.cymitquimica.com/products/IN/thumb/DA003PBJ.jpg)
6,7,9,10,12,13-Hexahydrodibenzo[b,e][1,4,7,10,13]pentaoxacyclopentadecine
Ref: IN-DA003PBJ
| 1g | 195.00 € | ||
| 5g | 559.00 € | ||
| 10g | To inquire | ||
| 100mg | 62.00 € | ||
| 250mg | 79.00 € |
Dibenzo-15-crown 5-Ether
Ref: 3D-FD62084
| 1g | Discontinued | Request information | |
| 2g | Discontinued | Request information | |
| 100mg | Discontinued | Request information | |
| 250mg | Discontinued | Request information | |
| 500mg | Discontinued | Request information |
