CAS 142621-29-2
:(2S)-2-{[(1S)-1-benzyl-2-{[(1S)-2-carboxy-1-hydroxyethyl]amino}-2-oxoethyl]amino}-4-(4-hydroxyphenyl)butanoic acid
Description:
The chemical substance with the name "(2S)-2-{[(1S)-1-benzyl-2-{[(1S)-2-carboxy-1-hydroxyethyl]amino}-2-oxoethyl]amino}-4-(4-hydroxyphenyl)butanoic acid" and CAS number "142621-29-2" is a complex organic compound characterized by multiple functional groups, including amino, carboxylic acid, and hydroxyl groups. This structure suggests it may exhibit both hydrophilic and hydrophobic properties, which can influence its solubility and interaction with biological systems. The presence of a benzyl group indicates potential for aromatic interactions, while the hydroxyphenyl moiety may contribute to its reactivity and ability to form hydrogen bonds. The stereochemistry, indicated by the (S) configurations, suggests specific spatial arrangements that could affect its biological activity and pharmacokinetics. Such compounds are often studied for their potential therapeutic applications, particularly in fields like medicinal chemistry, where their ability to interact with biological targets is of interest. Overall, this compound's intricate structure and functional diversity make it a candidate for further investigation in drug development and biochemical research.
Formula:C22H26N2O7
InChI:InChI=1/C22H26N2O7/c25-16-9-6-14(7-10-16)8-11-17(22(30)31)23-18(12-15-4-2-1-3-5-15)21(29)24-19(26)13-20(27)28/h1-7,9-10,17-19,23,25-26H,8,11-13H2,(H,24,29)(H,27,28)(H,30,31)/t17-,18-,19-/m0/s1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Sch 47896
CAS:Sch 47896 is an inhibitor of neutral metalloendopeptidase (NEP).Formula:C22H26N2O7Color and Shape:SolidMolecular weight:430.45
