CAS 142628-53-3
:Macrocarpal C
Description:
Macrocarpal C is a natural compound classified as a phenolic compound, primarily derived from the leaves and fruits of the Macaranga genus, particularly Macaranga tanarius. It exhibits a complex structure characterized by multiple aromatic rings and hydroxyl groups, contributing to its potential biological activities. Macrocarpal C has garnered interest in the field of medicinal chemistry due to its reported antioxidant, anti-inflammatory, and antimicrobial properties. These characteristics suggest its potential utility in various therapeutic applications, including the development of natural products for health supplements or pharmaceuticals. Additionally, its unique chemical structure may allow for further exploration in synthetic chemistry to enhance its efficacy or bioavailability. As with many natural compounds, research is ongoing to fully elucidate its mechanisms of action and potential benefits in health and disease management. Overall, Macrocarpal C represents a fascinating subject of study within the realm of natural product chemistry and its applications in medicine.
Formula:C28H38O5
InChI:InChI=1/C28H38O5/c1-14(2)11-20(21-25(32)17(12-29)24(31)18(13-30)26(21)33)28(6)10-9-16-15(3)7-8-19-23(22(16)28)27(19,4)5/h12-14,16,19-20,22-23,31-33H,3,7-11H2,1-2,4-6H3/t16-,19+,20-,22+,23+,28+/m0/s1
InChI key:InChIKey=IEWHEHWXBLPFER-HUCVFKCKSA-N
SMILES:[C@@H](CC(C)C)([C@]1(C)[C@]2([C@]3([C@](C3(C)C)(CCC(=C)[C@@]2(CC1)[H])[H])[H])[H])C4=C(O)C(C=O)=C(O)C(C=O)=C4O
Synonyms:- 1,3-Benzenedicarboxaldehyde, 5-[1-(decahydro-1,1,7-trimethyl-4-methylene-1H-cycloprop[e]azulen-7-yl)-3-methylbutyl]-2,4,6-trihydroxy-, [1aR-[1aα,4aα,7β(R*),7aβ,7bα]]-
- Macrocarpal C
- 1,3-Benzenedicarboxaldehyde, 5-[(1R)-1-[(1aR,4aR,7S,7aR,7bR)-decahydro-1,1,7-trimethyl-4-methylene-1H-cycloprop[e]azulen-7-yl]-3-methylbutyl]-2,4,6-trihydroxy-
- 1H-Cycloprop[e]azulene, 1,4-benzenedicarboxaldehyde deriv.
- 5-[(1R)-1-[(1aR,4aR,7S,7aR,7bR)-Decahydro-1,1,7-trimethyl-4-methylene-1H-cycloprop[e]azulen-7-yl]-3-methylbutyl]-2,4,6-trihydroxy-1,3-benzenedicarboxaldehyde
- Macrocarpal C/G
- 5-[(1R)-1-[(1aR,4aR,7S,7aR,7bR)-1,1,7-trimethyl-4-methylidene-1a,2,3,4a,5,6,7a,7b-octahydrocyclopropa[h]azulen-7-yl]-3-methylbutyl]-2,4,6-trihydroxybenzene-1,3-dicarbaldehyde
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Macrocarpal C
CAS:Formula:C28H38O5Purity:95%~99%Color and Shape:Yellow powderMolecular weight:454.607Macrocarpal C
CAS:<p>Macrocarpal C from Eucalyptus globulus leaves is its main antifungal, increasing membrane permeability, ROS, and DNA fragmentation.</p>Formula:C28H38O5Purity:98%Color and Shape:SolidMolecular weight:454.607Macrocarpal C
CAS:<p>Macrocarpal C is a bioactive compound, which is a natural extract sourced from the leaves of Eucalyptus macrocarpa. It functions as an antimicrobial and anti-inflammatory agent, acting through the inhibition of microbial growth and reduction of inflammation-related pathways. This compound interferes with the cellular processes of pathogens, leading to their inactivation and death, while simultaneously modulating the host's immune response to mitigate inflammation.</p>Formula:C28H38O5Purity:Min. 95%Molecular weight:454.6 g/mol



