CAS 1426291-15-7

1,2,4-Oxadiazole, 5-(3-azetidinyl)-3-(4-chlorophenyl)-, hydrochloride (1:1)

Description:

1,2,4-Oxadiazole, 5-(3-azetidinyl)-3-(4-chlorophenyl)-, hydrochloride (1:1) is a chemical compound characterized by its oxadiazole ring, which is a five-membered heterocyclic structure containing two nitrogen atoms and three carbon atoms. The presence of a 3-azetidinyl group indicates a four-membered saturated ring that contributes to the compound's biological activity. The 4-chlorophenyl substituent introduces a chlorine atom on a phenyl ring, which can enhance lipophilicity and influence the compound's interaction with biological targets. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can facilitate its use in pharmaceutical applications. The compound may exhibit various pharmacological properties, potentially making it of interest in medicinal chemistry. Its specific characteristics, such as melting point, solubility, and stability, would depend on the molecular interactions and the environment in which it is studied. Further research would be necessary to elucidate its complete profile and potential applications.

Formula: C₁₁H₁₀ClN₃O·ClH

InChI: InChI=1S/C11H10ClN3O.ClH/c12-9-3-1-7(2-4-9)10-14-11(16-15-10)8-5-13-6-8;/h1-4,8,13H,5-6H2;1H

InChI key: InChIKey=RFUHTVCOLGZSMA-UHFFFAOYSA-N

SMILES: ClC1=CC=C(C=2N=C(ON2)C3CNC3)C=C1.Cl

Synonyms:

• 1,2,4-Oxadiazole, 5-(3-azetidinyl)-3-(4-chlorophenyl)-, hydrochloride (1:1)

5-azetidin-3-yl-3-(4-chlorophenyl)-1,2,4-oxadiazole hydrochloride

CAS: 1426291-15-7

Purity: 95.0%

Molecular weight: 272.1300048828125

Ref: 10-F542022