CAS 14263-94-6
:4,4′-Bi[2-methoxybenzenediazonium] tetrachlorozincate
Description:
4,4′-Bi[2-methoxybenzenediazonium] tetrachlorozincate, with the CAS number 14263-94-6, is a complex chemical compound characterized by its unique structure and properties. It consists of two 2-methoxybenzenediazonium units linked by a biphenyl framework, which contributes to its stability and reactivity. The presence of the tetrachlorozincate anion indicates that it contains zinc in a coordination complex with four chloride ions, enhancing its solubility and interaction with other chemical species. This compound is typically used in organic synthesis, particularly in the formation of azo compounds and as a reagent in various coupling reactions. Its diazonium groups are known for their ability to undergo electrophilic substitution, making it valuable in dye chemistry and materials science. Additionally, the methoxy groups provide electron-donating effects, influencing the reactivity and stability of the compound. Overall, 4,4′-Bi[2-methoxybenzenediazonium] tetrachlorozincate is significant in both academic research and industrial applications due to its versatile chemical behavior.
Formula:C14H12N4O2·Cl4Zn
InChI:InChI=1S/C14H12N4O2.4ClH.Zn/c1-19-13-7-9(3-5-11(13)17-15)10-4-6-12(18-16)14(8-10)20-2;;;;;/h3-8H,1-2H3;4*1H;/q+2;;;;;+2/p-4
InChI key:InChIKey=GPPKNJIWDULNQH-UHFFFAOYSA-J
SMILES:O(C)C=1C=C(C=CC1[N+]#N)C2=CC(OC)=C([N+]#N)C=C2.[Zn+2]([Cl-])([Cl-])([Cl-])[Cl-]
Synonyms:- [1,1′-Biphenyl]-4,4′-bis(diazonium), 3,3′-dimethoxy-, (T-4)-tetrachlorozincate(2-) (1:1)
- Zincate(2-), tetrachloro-, (T-4)-, 3,3′-dimethoxy[1,1′-biphenyl]-4,4′-bis(diazonium) (1:1)
- 2-Methoxy-4-(3-methoxy-4-diazobenzene)benzenediazonium tetrachlorozincate
- 4,4′-Bi[2-methoxybenzenediazonium] tetrachlorozincate
- Benzenediazonium, 4,4′-bis[o-methoxy-, tetrachlorozincate(2-) (2:1)
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Fast Blue B Salt
CAS:Fast Blue B SaltFormula:C14H12N4O2·Zn·4ClColor and Shape: yellow powderMolecular weight:475.49168g/molFast Blue B salt
CAS:Formula:C14H12N4O2Cl2·ZnCl2Color and Shape:Yellow, green, grey or dark brown powderMolecular weight:475.47Fast Blue B Salt
CAS:Fast Blue B Salt, a fat-soluble and phenolic compound-binding dye, serves for semi-quantitative analysis of alkylresorcinols in rye and forms a coloredFormula:C14H12Cl4N4O2ZnColor and Shape:SolidMolecular weight:475.49Fast Blue B Salt
CAS:Applications Fast Blue B Salt is a stain that is used for the determination of various compounds. It has been used to demonstrate esterase activity. Histochemically it has stained enterochromaffin cells and cells that have gone under free radical oxidative damage. It can be used as reactant/reagent in one pot preparation of phenanthroline-based shape-persistent fluorescent macrocycle using Sonogashira coupling. Dyes and metabolites.
References Nadeem, S., et al.: Lett Org Chem, 12, 504 (2015)Formula:C14H12N4O2·Cl4ZnColor and Shape:Yellow To Dark BrownMolecular weight:475.49Fast blue B salt
CAS:For visualizing enzymatic activityFormula:C14H12N4O2Cl2·ZnCl2Color and Shape:PowderMolecular weight:475.46 g/molFast Blue B Salt (DBB)
CAS:Formula:C14H12N4O2Cl2·ZnCl2Color and Shape:Yellowish green to blackish grey, PowderMolecular weight:475.47






