
CAS 1426309-26-3
:5-Fluoro-3-iodo-6-methyl-1H-pyrazolo[3,4-b]pyridine
Description:
5-Fluoro-3-iodo-6-methyl-1H-pyrazolo[3,4-b]pyridine is a heterocyclic compound characterized by its pyrazolo-pyridine structure, which incorporates both fluorine and iodine substituents. This compound features a five-membered pyrazole ring fused to a six-membered pyridine ring, contributing to its unique chemical properties. The presence of the fluorine atom typically enhances the compound's lipophilicity and can influence its reactivity and biological activity. The iodine substituent may also impart distinctive characteristics, such as increased molecular weight and potential for halogen bonding. The methyl group at the 6-position can affect the steric and electronic properties of the molecule. This compound is of interest in medicinal chemistry and drug development due to its potential biological activities, which may include antimicrobial or anticancer properties. Its specific reactivity and interactions would depend on the functional groups present and the overall molecular structure, making it a subject of study in various chemical and pharmaceutical applications.
Formula:C7H5FIN3
InChI:InChI=1S/C7H5FIN3/c1-3-5(8)2-4-6(9)11-12-7(4)10-3/h2H,1H3,(H,10,11,12)
InChI key:InChIKey=RTYHZLCIVUEWMQ-UHFFFAOYSA-N
SMILES:IC=1C=2C(=NC(C)=C(F)C2)NN1
Synonyms:- 5-Fluoro-3-iodo-6-methyl-1H-pyrazolo[3,4-b]pyridine
- 1H-Pyrazolo[3,4-b]pyridine, 5-fluoro-3-iodo-6-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.