
CAS 142632-33-5
:(10R,11S,12R)-11,12-Dihydro-12-hydroxy-6,6,10,11-tetramethyl-4-propyl-2H,6H,10H-benzo[1,2-b:3,4-b′:5,6-b′′]tripyran-2-one
Description:
The chemical substance known as (10R,11S,12R)-11,12-Dihydro-12-hydroxy-6,6,10,11-tetramethyl-4-propyl-2H,6H,10H-benzo[1,2-b:3,4-b′:5,6-b′′]tripyran-2-one, with the CAS number 142632-33-5, is a complex organic compound characterized by its unique polycyclic structure. This compound features multiple chiral centers, which contribute to its stereochemistry and potential biological activity. The presence of hydroxyl groups indicates that it may exhibit hydrogen bonding capabilities, influencing its solubility and reactivity. The tetramethyl and propyl substituents suggest that it has a relatively bulky structure, which could affect its interactions with biological targets. Such compounds are often studied for their potential pharmacological properties, including antioxidant or anti-inflammatory activities. The intricate arrangement of rings and functional groups may also play a role in its ability to interact with various enzymes or receptors in biological systems. Overall, this substance represents a fascinating area of study within organic chemistry and medicinal chemistry, with implications for drug development and natural product research.
Formula:C22H26O5
InChI:InChI=1S/C22H26O5/c1-6-7-13-10-15(23)26-21-16(13)20-14(8-9-22(4,5)27-20)19-17(21)18(24)11(2)12(3)25-19/h8-12,18,24H,6-7H2,1-5H3/t11-,12-,18-/m1/s1
InChI key:InChIKey=NIDRYBLTWYFCFV-SEDUGSJDSA-N
SMILES:C(CC)C=1C2=C(C3=C(C4=C2OC(C)(C)C=C4)O[C@H](C)[C@@H](C)[C@H]3O)OC(=O)C1
Synonyms:- (+)-Calanolide B
- 2H,6H,10H-Benzo[1,2-b:3,4-b′:5,6-b′′]tripyran-2-one, 11,12-dihydro-12-hydroxy-6,6,10,11-tetramethyl-4-propyl-, (10R,11S,12R)-
- 2H,6H,10H-Benzo[1,2-b:3,4-b′:5,6-b′′]tripyran-2-one, 11,12-dihydro-12-hydroxy-6,6,10,11-tetramethyl-4-propyl-, [10R-(10α,11β,12β)]-
- Calanolide B
- (10R,11S,12R)-11,12-Dihydro-12-hydroxy-6,6,10,11-tetramethyl-4-propyl-2H,6H,10H-benzo[1,2-b:3,4-b′:5,6-b′′]tripyran-2-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
Calanolide B
CAS:Calanolide B is one of a novel class of HIV-inhibiting coumarins from the tropical rainforest tree, Calophyllum lanigerum.Formula:C22H26O5Color and Shape:SolidMolecular weight:370.44
