CAS 142647-71-0
:2,4,6-trihydroxy-5-{1-[7-(2-hydroxypropan-2-yl)-1,4-dimethyl-1,2,3,3a,4,5,6,7-octahydroazulen-1-yl]-3-methylbutyl}benzene-1,3-dicarbaldehyde
Description:
2,4,6-Trihydroxy-5-{1-[7-(2-hydroxypropan-2-yl)-1,4-dimethyl-1,2,3,3a,4,5,6,7-octahydroazulen-1-yl]-3-methylbutyl}benzene-1,3-dicarbaldehyde, with CAS number 142647-71-0, is a complex organic compound characterized by its multiple functional groups, including hydroxyl (-OH) and aldehyde (-CHO) groups. This structure suggests it may exhibit significant reactivity, particularly in forming hydrogen bonds and participating in condensation reactions. The presence of the bulky octahydroazulene moiety indicates potential hydrophobic characteristics, which could influence its solubility in various solvents. Additionally, the compound's multiple aromatic rings may contribute to its stability and potential for π-π stacking interactions. Given its intricate structure, it may possess unique biological activities or applications in fields such as pharmaceuticals or materials science. However, specific properties such as melting point, boiling point, and solubility would require empirical data for precise characterization. Overall, this compound exemplifies the complexity often found in organic chemistry, particularly in the design of multifunctional molecules.
Formula:C28H40O6
InChI:InChI=1/C28H40O6/c1-15(2)11-22(23-25(32)19(13-29)24(31)20(14-30)26(23)33)28(6)10-9-18-16(3)7-8-17(12-21(18)28)27(4,5)34/h12-18,22,31-34H,7-11H2,1-6H3
SMILES:CC(C)CC(c1c(c(C=O)c(c(C=O)c1O)O)O)C1(C)CCC2C(C)CCC(C=C12)C(C)(C)O
Synonyms:- 2,4,6-Trihydroxy-5-(1-(5-(1-Hydroxy-Isopropyl)-2,8-Dimethylbicyclo(5.3.0)Dec-6-En-8-Yl)-3-Methylbutyl)Benzene-1,3-Dicarbaldehyde
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 3 products.
Macrocarpal D
CAS:Macrocarpal D is a HIV-RTase inhibitor. It has antibacterial activity.Formula:C28H40O6Purity:98%Color and Shape:SolidMolecular weight:472.61Macrocarpal D
CAS:Formula:C28H40O6Purity:95%~99%Color and Shape:Yellow powderMolecular weight:472.622Macrocarpal D
CAS:<p>Macrocarpal D is a bioactive compound isolated from the leaves of certain *Eucalyptus* species. As a natural product, it originates from plant secondary metabolites, specifically within the genus *Eucalyptus*, which is renowned for its diverse array of phytochemicals. The mode of action of Macrocarpal D involves disrupting microbial cell membranes and inhibiting microbial enzymes, thereby exerting its antimicrobial effects.</p>Formula:C28H40O6Purity:Min. 95%Color and Shape:PowderMolecular weight:472.6 g/mol


