CAS 14265-44-2
:Phosphate
Description:
The chemical substance referred to as "Phosphate" with the CAS number 14265-44-2 is a specific form of phosphate, typically associated with its role in various biological and chemical processes. Phosphates are salts or esters of phosphoric acid and contain the phosphate ion (PO4^3−). They are characterized by their ability to form strong ionic bonds, making them soluble in water, which is crucial for their function in biological systems, such as energy transfer through ATP (adenosine triphosphate) and as a structural component of DNA and RNA. Phosphates are also important in agriculture as fertilizers, enhancing plant growth by providing essential phosphorus. In terms of chemical properties, phosphates can exhibit varying degrees of acidity and can participate in acid-base reactions. They are generally stable under normal conditions but can react with strong acids or bases. Additionally, phosphates can form complexes with metals, influencing their bioavailability and environmental behavior. Overall, phosphates play a vital role in both ecological systems and industrial applications.
Formula:O4P
InChI:InChI=1S/H3O4P/c1-5(2,3)4/h(H3,1,2,3,4)/p-3
InChI key:InChIKey=NBIIXXVUZAFLBC-UHFFFAOYSA-K
SMILES:P(=O)([O-])([O-])[O-]
Synonyms:- Phosphate
- Phosphate ions
- Orthophosphate
- Phosphate ion (PO43-)
- Orthophosphate (PO43-)
- Phosphate (PO43-)
- Orthophosphate
- O-Phosphate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
