CAS 142651-19-2

1-[3-(1,1-Dimethylethyl)-4-methoxyphenyl]ethanone

Description:

1-[3-(1,1-Dimethylethyl)-4-methoxyphenyl]ethanone, also known by its CAS number 142651-19-2, is an organic compound characterized by its ketone functional group and aromatic structure. This compound features a phenyl ring substituted with a tert-butyl group and a methoxy group, contributing to its unique chemical properties. The presence of the ketone group indicates that it can participate in various chemical reactions, such as nucleophilic addition and oxidation. Its molecular structure suggests potential applications in organic synthesis and as an intermediate in the production of pharmaceuticals or agrochemicals. The tert-butyl group enhances the compound's hydrophobicity, which may influence its solubility and reactivity in different solvents. Additionally, the methoxy group can affect the electronic properties of the aromatic ring, potentially impacting its reactivity and interactions with other molecules. Overall, this compound's distinctive structure and functional groups make it of interest in various fields of chemistry, including medicinal and synthetic chemistry.

Formula: C₁₃H₁₈O₂

InChI: InChI=1S/C13H18O2/c1-9(14)10-6-7-12(15-5)11(8-10)13(2,3)4/h6-8H,1-5H3

InChI key: InChIKey=FKTGMOQEGIONRC-UHFFFAOYSA-N

SMILES: C(C)(C)(C)C1=C(OC)C=CC(C(C)=O)=C1

1-(3-tert-butyl-4-methoxyphenyl)ethanone

CAS: 142651-19-2

Formula: C₁₃H₁₈O₂

Molecular weight: 206.285

Ref: 10-F366155