CAS 142654-73-7
:11-(piperidin-4-ylidene)-6,11-dihydro-5H-imidazo[2,1-b][3]benzazepine
Description:
11-(Piperidin-4-ylidene)-6,11-dihydro-5H-imidazo[2,1-b][3]benzazepine, with the CAS number 142654-73-7, is a chemical compound characterized by its complex bicyclic structure that incorporates both imidazole and benzazepine moieties. This compound typically exhibits properties such as moderate solubility in organic solvents and potential bioactivity, making it of interest in medicinal chemistry. The presence of the piperidine ring suggests that it may interact with biological targets, potentially influencing neurotransmitter systems or other cellular pathways. Its structural features may contribute to its pharmacological profile, including possible effects on receptor binding or enzyme inhibition. As with many compounds in this class, the specific characteristics, such as melting point, boiling point, and spectral data, would depend on the purity and specific conditions under which the compound is studied. Overall, this compound represents a class of heterocyclic compounds that may have applications in drug development and therapeutic research.
Formula:C17H19N3
InChI:InChI=1/C17H19N3/c1-2-4-15-13(3-1)7-11-20-12-10-19-17(20)16(15)14-5-8-18-9-6-14/h1-4,10,12,18H,5-9,11H2
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
11-(Piperidin-4-ylidene)-6,11-dihydro-5H-benzo[d]imidazo[1,2-a]azepine
CAS:Formula:C17H19N3Molecular weight:265.36
