CAS 14266-19-4

Benzoic acid, 3,5-diiodo-, methyl ester

Description:

Benzoic acid, 3,5-diiodo-, methyl ester, with the CAS number 14266-19-4, is an organic compound characterized by the presence of a benzoic acid moiety substituted with two iodine atoms at the 3 and 5 positions and a methyl ester functional group. This compound typically appears as a solid or crystalline substance and is known for its relatively low solubility in water, while being more soluble in organic solvents such as ethanol and acetone. The presence of iodine atoms contributes to its unique chemical properties, including increased reactivity and potential applications in various fields such as pharmaceuticals and agrochemicals. The methyl ester group enhances its lipophilicity, making it suitable for certain biological applications. Additionally, the compound may exhibit antimicrobial and antifungal properties, which can be of interest in research and development. As with many halogenated compounds, safety precautions should be taken due to potential toxicity and environmental impact.

Formula: C₈H₆I₂O₂

InChI: InChI=1S/C8H6I2O2/c1-12-8(11)5-2-6(9)4-7(10)3-5/h2-4H,1H3

InChI key: InChIKey=YYSITUQNFNKVLR-UHFFFAOYSA-N

SMILES: C(OC)(=O)C1=CC(I)=CC(I)=C1

Synonyms:

• 3,5-Diiodobenzoic acid methyl ester
• Benzoic acid, 3,5-diiodo-, methyl ester
• Methyl 3,5-diiodobenzoate

Methyl 3,5-diiodobenzoate

CAS: 14266-19-4

Versatile small molecule scaffold

Formula: C₈H₆I₂O₂

Purity: Min. 95%

Molecular weight: 387.94 g/mol

Ref: 3D-PAA26619